| Name |
Izalpinin 7-O-Methylgalangin Galangin 7-methyl ether 3,5-Dihydroxy-7-methoxy-2-phenyl-4H-1-benzopyran-4-one 3,5-Dihydroxy-7-methoxyflavone |
| Formula |
C16H12O5 |
| Mw |
284.06847349 |
| CAS RN |
480-14-8 |
| C_ID |
C00004536
, 
|
| InChIKey |
PVJNLMXWZXXHSZ-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C16H12O5/c1-20-10-7-11(17)13-12(8-10)21-16(15(19)14(13)18)9-5-3-2-4-6-9/h2-8,17,19H,1H3 |
| SMILES |
COc1cc(O)c2c(=O)c(O)c(-c3ccccc3)oc2c1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Animalia | Cyprinidae | Carassius auratus  | Ref. |
| Plantae | Asteraceae | Baccharis viminea | Ref. |
| Plantae | Asteraceae | Flourensia resinosa | Ref. |
| Plantae | Asteraceae | Helichrysum aureum | Ref. |
| Plantae | Asteraceae | Olearia nummularifolia | Ref. |
| Plantae | Asteraceae | Ozothamnus ledifolius | Ref. |
| Plantae | Boraginaceae | Heliotropium pycnophyllum | Ref. |
| Plantae | Capparaceae | Capparis tweediana  | Ref. |
| Plantae | Iridaceae | Iris tenuifolia | Ref. |
| Plantae | Myricaceae | Comptonia peregrina  | Ref. |
| Plantae | Nothofagaceae/Fagaceae | Nothofagus antarctica | Ref. |
| Plantae | Nothofagaceae/Fagaceae | Nothofagus spp. | Ref. |
| Plantae | Pinaceae | Pinus morrisonicola | Ref. |
| Plantae | Pteridaceae | Platyzoma microphyllum | Ref. |
| Plantae | Zamiaceae | Apis mellifera ligustica  | Ref. |
| Plantae | Zingiberaceae | Alpinia chinensis | Ref. |
| Plantae | Zingiberaceae | Alpinia japonica | Ref. |
| Plantae | Zingiberaceae | Alpinia oxyphylla  | Ref. |
|
|
zoom in
| Organism | Platyzoma microphyllum | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 181.Flavonols
Kimura,Yakugaku Zasshi,55,(1935),229
Goel,Proc.Indian Acad.Sci..Sect. A,47,(1958)191 |
|---|
|