| Name |
5,6,4'-Trihydroxy-7,3'-dimethoxyflavone 6-Hydroxyluteolin 7,3'-dimethyl ether 5,6-Dihydroxy-2-(4-hydroxy-3-methoxyphenyl)-7-methoxy-4H-1-benzopyran-4-one |
| Formula |
C17H14O7 |
| Mw |
330.0739528 |
| CAS RN |
25782-25-6 |
| C_ID |
C00003892
, 
|
| InChIKey |
LRUIASUJJNMESX-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C17H14O7/c1-22-12-5-8(3-4-9(12)18)11-6-10(19)15-13(24-11)7-14(23-2)16(20)17(15)21/h3-7,18,20-21H,1-2H3 |
| SMILES |
COc1cc(-c2cc(=O)c3c(O)c(O)c(OC)cc3o2)ccc1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Arctotis venusta | Ref. |
| Plantae | Asteraceae | Artemisia argyi  | Ref. |
| Plantae | Labiatae | Clinopodium nepeta | Ref. |
| Plantae | Labiatae | Mentha longifolia  | Ref. |
| Plantae | Labiatae | Mentha pulegium  | Ref. |
| Plantae | Labiatae | Mentha spicata  | Ref. |
| Plantae | Labiatae | Mentha spp.  | Ref. |
| Plantae | Labiatae | Mentha suaveolens  | Ref. |
| Plantae | Labiatae | Micromeria spp. | Ref. |
| Plantae | Labiatae | Ocimum lamiifolium  | Ref. |
| Plantae | Labiatae | Origanum calcaratum | Ref. |
| Plantae | Labiatae | Origanum dictamnus  | Ref. |
| Plantae | Labiatae | Origanum floribundum | Ref. |
| Plantae | Labiatae | Origanum majorana  | Ref. |
| Plantae | Labiatae | Origanum microphyllum | Ref. |
| Plantae | Labiatae | Origanum onites  | Ref. |
| Plantae | Labiatae | Origanum spp. | Ref. |
| Plantae | Labiatae | Origanum syriacum  | Ref. |
| Plantae | Labiatae | Origanum vulgare subsp. Glandulosum  | Ref. |
| Plantae | Labiatae | Origanum vulgare subsp. Hirtum  | Ref. |
| Plantae | Labiatae | Origanum x intercedens | Ref. |
| Plantae | Labiatae | Thymbra capitata  | Ref. |
| Plantae | Labiatae | Thymbra spicata | Ref. |
| Plantae | Labiatae | Thymus satureioides | Ref. |
| Plantae | Lamiaceae | Acinos alpinus  | Ref. |
| Plantae | Lamiaceae | Acinos suaveolens | Ref. |
| Plantae | Lamiaceae | Calamintha nepeta  | Ref. |
| Plantae | Monocleaceae | Monoclea gottschei | Ref. |
| Plantae | Verbenaceae | Citharexylum subserratum | Ref. |
|
|
zoom in
| Organism | Origanum majorana | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 2, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|