| Name |
ladanetin Sorbifolin |
| Formula |
C16H12O6 |
| Mw |
300.06338812 |
| CAS RN |
23130-22-5 |
| C_ID |
C00003835
, 
|
| InChIKey |
UWARRXZVZDFPQU-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C16H12O6/c1-21-13-7-12-14(16(20)15(13)19)10(18)6-11(22-12)8-2-4-9(17)5-3-8/h2-7,17,19-20H,1H3 |
| SMILES |
COc1cc2oc(-c3ccc(O)cc3)cc(=O)c2c(O)c1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Ambrosia ambrosioides | Ref. |
| Plantae | Asteraceae | Anvillea garcinii | Ref. |
| Plantae | Asteraceae | Onopordon sibthorpianum | Ref. |
| Plantae | Asteraceae | Pleocarphus revolutus | Ref. |
| Plantae | Bignoniaceae | Adenocalymma alliaceum  | Ref. |
| Plantae | Clusiaceae/Clusiaceae-Guttiferae | Garcinia andamanica | Ref. |
| Plantae | Fabaceae | Pterogyne nitens | Ref. |
| Plantae | Hydrocharitaceae | Halophila johnsonii | Ref. |
| Plantae | Labiatae | Mentha piperita  | Ref. |
| Plantae | Labiatae | Mentha pulegium  | Ref. |
| Plantae | Labiatae | Mentha x piperita | Ref. |
| Plantae | Labiatae | Origanum calcaratum | Ref. |
| Plantae | Labiatae | Origanum dictamnus  | Ref. |
| Plantae | Labiatae | Origanum floribundum | Ref. |
| Plantae | Labiatae | Origanum majorana  | Ref. |
| Plantae | Labiatae | Origanum microphyllum | Ref. |
| Plantae | Labiatae | Origanum onites  | Ref. |
| Plantae | Labiatae | Origanum syriacum  | Ref. |
| Plantae | Labiatae | Origanum vulgare subsp. Glandulosum  | Ref. |
| Plantae | Labiatae | Origanum vulgare subsp. Hirtum  | Ref. |
| Plantae | Labiatae | Thymus herba-barona  | Ref. |
| Plantae | Plantaginaceae | Scoparia dulcis  | Ref. |
| Plantae | Rosaceae | Sorbaria sorbifolia  | Ref. |
| Plantae | Rosaceae | Sorbaria stellipila | Ref. |
| Plantae | Rutaceae | Spathelia glabrescens | Ref. |
| Plantae | Rutaceae | Spathelia sorbifolia | Ref. |
| - | - | Sanbaria stellipila | Ref. |
|
|
zoom in
| Organism | Origanum floribundum | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 2, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|