| Name |
Vitexin 8-D-Glucosyl-4',5,7-trihydroxyflavone Apigenin 8-C-glucoside 8-beta-D-Glucopyranosyl-5,7-dihydroxy-2-(4-hydroxyphenyl)-4H-1-benzopyran-4-one |
| Formula |
C21H20O10 |
| Mw |
432.10564686 |
| CAS RN |
3681-93-4 |
| C_ID |
C00001110
, 
|
| InChIKey |
SGEWCQFRYRRZDC-RJFRUACSNA-N |
| InChICode |
InChI=1S/C21H20O10/c22-7-14-17(27)18(28)19(29)21(31-14)16-11(25)5-10(24)15-12(26)6-13(30-20(15)16)8-1-3-9(23)4-2-8/h1-6,14,17-19,21-25,27-29H,7H2/t14-,17+,18-,19+,21-/m0/s1 |
| SMILES |
O=c1cc(-c2ccc(O)cc2)oc2c([C@@H]3OC(CO)[C@@H](O)[C@H](O)C3O)c(O)cc(O)c12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Acanthaceae | Adhatoda vasica  | Ref. |
| Plantae | Acanthaceae | Clinacanthus nutans | Ref. |
| Plantae | Araceae | Anthurium versicolor | Ref. |
| Plantae | Araceae | Colocasia esculenta  | Ref. |
| Plantae | Araceae | Colocasia escultenta | Ref. |
| Plantae | Asteraceae | Artemisia annua  | Ref. |
| Plantae | Cannabaceae | Humulus japonicus | Ref. |
| Plantae | Caryophyllaceae | Lychnis flos-cuculi L. | Ref. |
| Plantae | Caryophyllaceae | Silene brahuica | Ref. |
| Plantae | Caryophyllaceae | Silene multijida | Ref. |
| Plantae | Caryophyllaceae | Silene repens | Ref. |
| Plantae | Caryophyllaceae | Silene supina | Ref. |
| Plantae | Caryophyllaceae | Silene turgida | Ref. |
| Plantae | Caryophyllaceae | Stellaria media  | Ref. |
| Plantae | Chloranthaceae | Ascarina lucida | Ref. |
| Plantae | Clusiaceae/Clusiaceae-Guttiferae | Garcinia dulcis  | Ref. |
| Plantae | Clusiaceae/Clusiaceae-Guttiferae | Garcinia hombroniana | Ref. |
| Plantae | Clusiaceae/Clusiaceae-Guttiferae | Garcinia purpurea | Ref. |
| Plantae | Clusiaceae/Clusiaceae-Guttiferae | Garcinia vitiens | Ref. |
| Plantae | Clusiaceae/Clusiaceae-Guttiferae | Garcinia xanthochymus  | Ref. |
| Plantae | Combretaceae | Combretum quadrangulare  | Ref. |
| Plantae | Commelinaceae | Commelina communis L  | Ref. |
| Plantae | Cucurbitaceae | Cucumis sativus  | Ref. |
| Plantae | Cucurbitaceae | Gynostemma pentaphyllum  | Ref. |
| Plantae | Cyatheaceae | Cyathea spp. | Ref. |
| Plantae | Cyperaceae | Kyllinga brevifolia  | Ref. |
| Plantae | Ephedraceae | Ephedra sinica  | Ref. |
| Plantae | Euphorbiaceae | Euphorbia supina Rafin | Ref. |
| Plantae | Fabaceae | Acacia furcatispina | Ref. |
| Plantae | Fabaceae | Acacia praecox | Ref. |
| Plantae | Fabaceae | Anthyllis subsimplex | Ref. |
| Plantae | Fabaceae | Crotalaria micans | Ref. |
| Plantae | Fabaceae | Crotalaria pallida  | Ref. |
| Plantae | Fabaceae | Crotalaria rotundifolia | Ref. |
| Plantae | Fabaceae | Crotalaria verrucosa  | Ref. |
| Plantae | Fabaceae | Cytisus eriocarpus | Ref. |
| Plantae | Fabaceae | Cytisus hirsutus | Ref. |
| Plantae | Fabaceae | Cytisus scoparius  | Ref. |
| Plantae | Fabaceae | Desmodium triflorum  | Ref. |
| Plantae | Fabaceae | Galactia glaucophylla | Ref. |
| Plantae | Fabaceae | Gleditsia japonica  | Ref. |
| Plantae | Fabaceae | Gleditsia sinensis  | Ref. |
| Plantae | Fabaceae | Gleditsia triacanthos  | Ref. |
| Plantae | Fabaceae | Glycine max  | Ref. |
| Plantae | Fabaceae | Glycyrrhiza echinata  | Ref. |
| Plantae | Fabaceae | Lespedeza capitata | Ref. |
| Plantae | Fabaceae | Lespedeza cuneata | Ref. |
| Plantae | Fabaceae | Lespedeza hedysaroides | Ref. |
| Plantae | Fabaceae | Lespedeza juncea | Ref. |
| Plantae | Fabaceae | Lespedeza spp. | Ref. |
| Plantae | Fabaceae | Lupinus arboreus | Ref. |
| Plantae | Fabaceae | Lupinus sericeus | Ref. |
| Plantae | Fabaceae | Lupinus subcarnosus | Ref. |
| Plantae | Fabaceae | Lupinus texensis | Ref. |
| Plantae | Fabaceae | Medicago medicaginoides | Ref. |
| Plantae | Fabaceae | Onobrychis angustifolia | Ref. |
| Plantae | Fabaceae | Ononis spinosa  | Ref. |
| Plantae | Fabaceae | Parkinsonia aculeata  | Ref. |
| Plantae | Fabaceae | Pisum sativum  | Ref. |
| Plantae | Fabaceae | Prosopis alba  | Ref. |
| Plantae | Fabaceae | Prosopis argentina | Ref. |
| Plantae | Fabaceae | Prosopis chilensis  | Ref. |
| Plantae | Fabaceae | Prosopis fiebrigii | Ref. |
| Plantae | Fabaceae | Prosopis hassleri | Ref. |
| Plantae | Fabaceae | Prosopis kuntzei  | Ref. |
| Plantae | Fabaceae | Prosopis nigra  | Ref. |
| Plantae | Fabaceae | Prosopis reptans | Ref. |
| Plantae | Fabaceae | Prosopis ruscifolia  | Ref. |
| Plantae | Fabaceae | Prosopis spp. | Ref. |
| Plantae | Fabaceae | Prosopis strombulifera  | Ref. |
| Plantae | Fabaceae | Prosopis vinalillo  | Ref. |
| Plantae | Fabaceae | Rhynchosia beddomei | Ref. |
| Plantae | Fabaceae | Rhynchosia cana | Ref. |
| Plantae | Fabaceae | Rhynchosia capitata | Ref. |
| Plantae | Fabaceae | Rhynchosia heynei | Ref. |
| Plantae | Fabaceae | Rhynchosia jacobii | Ref. |
| Plantae | Fabaceae | Rhynchosia minima  | Ref. |
| Plantae | Fabaceae | Rhynchosia rufescens | Ref. |
| Plantae | Fabaceae | Rhynchosia suaveolens | Ref. |
| Plantae | Fabaceae | Spartium junceum  | Ref. |
| Plantae | Fabaceae | Tamarindus indica  | Ref. |
| Plantae | Fabaceae | Trifolium pratense  | Ref. |
| Plantae | Fabaceae | Trigonella balansae | Ref. |
| Plantae | Fabaceae | Trigonella foenum-graecum  | Ref. |
| Plantae | Fabaceae | Trigonella grandiflora | Ref. |
| Plantae | Fabaceae | Vigna mungo  | Ref. |
| Plantae | Fabaceae | Vigna radiata  | Ref. |
| Plantae | Fabaceae | Vigna trilobata | Ref. |
| Plantae | Geraniaceae | Pelargonium reniforme | Ref. |
| Plantae | Geraniaceae | Pelargonium sidoides  | Ref. |
| Plantae | Ginkgoaceae | Ginkgo biloba  | Ref. |
| Plantae | Labiatae | Isodon oresbia | Ref. |
| Plantae | Labiatae | Isodon oresbius | Ref. |
| Plantae | Labiatae | Origanum vulgare  | Ref. |
| Plantae | Labiatae | Salvia blepharophylla | Ref. |
| Plantae | Labiatae | Stachys scardica Griseb. | Ref. |
| Plantae | Labiatae | Vitex littoralis | Ref. |
| Plantae | Labiatae | Vitex lucens | Ref. |
| Plantae | Labiatae | Vitex polygama | Ref. |
| Plantae | Labiatae | Vitex trifolia  | Ref. |
| Plantae | Malvaceae | Theobroma cacao L.  | Ref. |
| Plantae | Moraceae | Broussonetia papyrifera  | Ref. |
| Plantae | Oxalidaceae | Oxalis corniculata  | Ref. |
| Plantae | Palmae | Cocos nucifera  | Ref. |
| Plantae | Passifloraceae | Passiflora serratodigitata | Ref. |
| Plantae | Pinaceae | Larix spp. | Ref. |
| Plantae | Poaceae | Pennisetum americanum  | Ref. |
| Plantae | Ranunculaceae | Adonis spp. | Ref. |
| Plantae | Ranunculaceae | Ranunculus japonicus | Ref. |
| Plantae | Ranunculaceae | Trollius chinensis | Ref. |
| Plantae | Ranunculaceae | Trollius ledebouri | Ref. |
| Plantae | Ranunculaceae | Trollius macropetalus | Ref. |
| Plantae | Rhamnaceae | Rhamnus davurica | Ref. |
| Plantae | Rosaceae | Crataegus hupehensis | Ref. |
| Plantae | Rosaceae | Crataegus kansuensis | Ref. |
| Plantae | Rosaceae | Crataegus maximowiczii  | Ref. |
| Plantae | Rosaceae | Crataegus oxyacantha  | Ref. |
| Plantae | Rosaceae | Crataegus pinnatifida  | Ref. |
| Plantae | Rosaceae | Crataegus pinnatifida var.major  | Ref. |
| Plantae | Rosaceae | Crataegus pinnatifida var.pilosula  | Ref. |
| Plantae | Rosaceae | Crataegus sanguinea  | Ref. |
| Plantae | Rosaceae | Crataegus scabrifolia | Ref. |
| Plantae | Rosaceae | Physocarpus capitatus | Ref. |
| Plantae | Rutaceae | Citrus reticulata  | Ref. |
| Plantae | Smilacaceae | Smilax bracteata | Ref. |
| Plantae | Taxaceae | Taxus fuana | Ref. |
| Plantae | Taxaceae | Taxus yunnanensis | Ref. |
| Plantae | Theaceae | Camellia sinensis (L.) O.KUNTZE  | Ref. |
| Plantae | Turneraceae | Turnera subulata | Ref. |
| Plantae | Vittariaceae | Vittaria anguste-elongata | Ref. |
|
|
zoom in
| Organism | Stellaria media | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 3, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|