| Name |
Swertiajaponin Leucanthoside 6-beta-D-glucopyranosyl-3',4',5-trihydroxy-7-methoxyflavone |
| Formula |
C22H22O11 |
| Mw |
462.11621155 |
| CAS RN |
6980-25-2 |
| C_ID |
C00001102
, 
|
| InChIKey |
DLVLXOYLQKCAME-FPRNEBIWNA-N |
| InChICode |
InChI=1S/C22H22O11/c1-31-13-6-14-16(11(26)5-12(32-14)8-2-3-9(24)10(25)4-8)19(28)17(13)22-21(30)20(29)18(27)15(7-23)33-22/h2-6,15,18,20-25,27-30H,7H2,1H3/t15-,18-,20+,21-,22+/m1/s1 |
| SMILES |
COc1cc2oc(-c3ccc(O)c(O)c3)cc(=O)c2c(O)c1[C@@H]1OC(CO)[C@@H](O)[C@H](O)C1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Achillea leptophylla | Ref. |
| Plantae | Asteraceae | Achillea spp. | Ref. |
| Plantae | Asteraceae | Tragopogon spp. | Ref. |
| Plantae | Dipsacaceae | Cephalaria leucantha | Ref. |
| Plantae | Dipsacaceae | Cephalaria uralensis | Ref. |
| Plantae | Dipsacaceae/Diervillaceae/Linnaeaceae/Valerianaceae | Knautia montana | Ref. |
| Plantae | Gentianaceae | Gentiana germanica | Ref. |
| Plantae | Gentianaceae | Gentiana ramosa | Ref. |
| Plantae | Gentianaceae | Swertia japonica  | Ref. |
| Plantae | Gentianaceae | Swertia mileensis | Ref. |
| Plantae | Gnetaceae | Gnetum gnemon  | Ref. |
| Plantae | Iridaceae | Iris germanica  | Ref. |
| Plantae | Iridaceae | Iris nertshinskia | Ref. |
| Plantae | Iridaceae | Iris ramosa | Ref. |
| Plantae | Iridaceae | Iris sanguinea | Ref. |
| Plantae | Poaceae | Cymbopogon citratus  | Ref. |
| Plantae | Poaceae | Deschampsia antarctica | Ref. |
| - | - | Pterocephalus plumosus | Ref. |
|
|
zoom in
| Organism | Iris ramosa | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 549,C-glycosylflavones
Komatsu,Tetrahedron Lett.,(1966),1611
Bouillant,APhytochem.,11,(1972),1858 |
|---|
|