| Name |
Isoledene
(-)-Isoledene |
| Formula |
C15H24 |
| Mw |
204.18780077 |
| CAS RN |
95910-36-4 |
| C_ID |
C00037332
, 
|
| InChIKey |
NUQDPKOFUKFKFD-FYUQUFDONA-N |
| InChICode |
InChI=1S/C15H24/c1-9-6-8-12-14(15(12,3)4)13-10(2)5-7-11(9)13/h9-10,12,14H,5-8H2,1-4H3/t9-,10-,12-,14-/m1/s1 |
| SMILES |
C[C@@H]1CC[C@@H]2[C@H](C3=C1CC[C@H]3C)C2(C)C |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Annonaceae | Xylopia sericea  | Ref. |
| Plantae | Araliaceae | Panax ginseng | Ref. |
| Plantae | Asteraceae | Ambrosia trifida | Ref. |
| Plantae | Asteraceae | Eupatorium adenophorum | Ref. |
| Plantae | Cannabaceae | Humulus lupulus | Ref. |
| Plantae | Labiatae | Ocimum basilicum | Ref. |
| Plantae | Lepidoziaceae | Lepidozia fauriana | Ref. |
| Plantae | Myrtaceae | Acca sellowiana | Ref. |
| Plantae | Piperaceae | Piper nigrum | Ref. |
| Plantae | Rutaceae | Murraya paniculata | Ref. |
| Plantae | Scapaniaceae | Tritomaria quinquedentata (Huds.) | Ref. |
| Plantae | Solanaceae | Solanum lycopersicum | Ref. |
| Plantae | Turneraceae | Turnera diffusa | Ref. |
| Plantae | Zingiberaceae | Zingiber officinale | Ref. |
|
|
zoom in
| Organism | Turnera diffusa |
|---|
| Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 4, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|
