| Name |
4-Caffeoylquinic acid Cryptochlorogenic acid 4-O-Caffeoylquinic acid |
| Formula |
C16H18O9 |
| Mw |
354.09508217 |
| CAS RN |
905-99-7 |
| C_ID |
C00029540
, 
|
| InChIKey |
GYFFKZTYYAFCTR-PCEXOASVNA-N |
| InChICode |
InChI=1S/C16H18O9/c17-9-3-1-8(5-10(9)18)2-4-13(21)25-14-11(19)6-16(24,15(22)23)7-12(14)20/h1-5,11-12,14,17-20,24H,6-7H2,(H,22,23)/b4-2+/t11-,12-,14-,16+/m1/s1 |
| SMILES |
O=C(/C=C/c1ccc(O)c(O)c1)O[C@H]1[C@H](O)C[C@](O)(C(=O)O)C[C@H]1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Apiaceae | Foeniculum vulgare  | Ref. |
| Plantae | Asteraceae | Artemisia annua  | Ref. |
| Plantae | Asteraceae | Cynara scolymus  | Ref. |
| Plantae | Asteraceae | Helianthus annuus  | Ref. |
| Plantae | Asteraceae | Helianthus sp. | Ref. |
| Plantae | Asteraceae | Matricaria recutita  | Ref. |
| Plantae | Asteraceae | Solidago altissima L. | Ref. |
| Plantae | Chloranthaceae | Sarcandra glabra  | Ref. |
| Plantae | Convolvulaceae | Ipomoea batatas  | Ref. |
| Plantae | Fabaceae | Pisum sativum  | Ref. |
| Plantae | Moraceae | Morus alba  | Ref. |
| Plantae | Moringaceae | Moringa oleifera  | Ref. |
| Plantae | Moringaceae | Moringa peregrina  | Ref. |
| Plantae | Moringaceae | Moringa peregrine | Ref. |
| Plantae | Moringaceae | Moringa stenopetala  | Ref. |
| Plantae | Rosaceae | Cydonia oblonga  | Ref. |
| Plantae | Rosaceae | Eriobotrya japonica  | Ref. |
| Plantae | Rosaceae | Prunus domestica  | Ref. |
| Plantae | Rubiaceae | Coffea sp.  | Ref. |
| Plantae | Solanaceae | Solanum habrochaites | Ref. |
| Plantae | Solanaceae | Solanum lycopersicum  | Ref. |
| Plantae | Solanaceae | Solanum neorickii | Ref. |
| Plantae | Solanaceae | Solanum parviflorum | Ref. |
| Plantae | Solanaceae | Solanum pennellii | Ref. |
| Plantae | Solanaceae | Solanum pimpinellifollium | Ref. |
| Plantae | Solanaceae | Solanum tuberosum  | Ref. |
| - | - | Caffea sp. | Ref. |
|
|
zoom in
| Organism | Moringa peregrina | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 2, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|