| Name |
3-O-beta-D-Glucopyranosyl sitosterol beta-Sitosterol glucoside beta-sitosterol-3-beta-O-D-glucopyranoside beta-Sitosterol-3-O-beta-D-glucoside beta-Sitosterol 3-O-beta-D-glucopyranoside Daucosterin Doursterol beta-Sitosteryl-glucoside Daucosterol beta-Daucosterol beta-Sitosterol 3-O-beta-glucopyranoside beta-Sitosteryl glucoside Sitosterol glucoside |
| Formula |
C35H60O6 |
| Mw |
576.43898965 |
| CAS RN |
474-58-8 |
| C_ID |
C00019308
, 
|
| InChIKey |
NPJICTMALKLTFW-ZWEMWMMCNA-N |
| InChICode |
InChI=1S/C35H60O6/c1-7-22(20(2)3)9-8-21(4)26-12-13-27-25-11-10-23-18-24(14-16-34(23,5)28(25)15-17-35(26,27)6)40-33-32(39)31(38)30(37)29(19-36)41-33/h10,20-22,24-33,36-39H,7-9,11-19H2,1-6H3/t21-,22-,24+,25+,26-,27+,28+,29+,30-,31+,32-,33-,34+,35-/m1/s1 |
| SMILES |
CC[C@H](CC[C@@H](C)[C@H]1CC[C@H]2[C@@H]3CC=C4C[C@@H](O[C@@H]5OC(CO)[C@@H](O)[C@H](O)C5O)CC[C@]4(C)[C@H]3CC[C@]12C)C(C)C |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Acanthaceae | Dicliptera riparia | Ref. |
| Plantae | Agavaceae | Agave americana  | Ref. |
| Plantae | Anacardiaceae | Rhus wallichi | Ref. |
| Plantae | Annonaceae | Annona purpurea  | Ref. |
| Plantae | Annonaceae | Artabotrys uncinatus  | Ref. |
| Plantae | Apiaceae | Ferula persica  | Ref. |
| Plantae | Apiaceae | Heracleum granatense | Ref. |
| Plantae | Apocynaceae | Cryptolepis obtusa  | Ref. |
| Plantae | Araliaceae | Centella asiatica  | Ref. |
| Plantae | Araliaceae | Hedera nepalensis K.Koch  | Ref. |
| Plantae | Araliaceae | Panax notoginseng  | Ref. |
| Plantae | Araliaceae | Schefflera capitata Harms. | Ref. |
| Plantae | Aristolochiaceae | Aristolochia heterophylla  | Ref. |
| Plantae | Aristolochiaceae | Aristolochia kaempferi | Ref. |
| Plantae | Asparagaceae | Asparagus officinalis  | Ref. |
| Plantae | Asteraceae | Achillea ageratum  | Ref. |
| Plantae | Asteraceae | Ajania fruticulosa  | Ref. |
| Plantae | Asteraceae | Artemisia minor | Ref. |
| Plantae | Asteraceae | Artemisia sieversiana  | Ref. |
| Plantae | Asteraceae | Centaurea bracteata Scop. | Ref. |
| Plantae | Asteraceae | Eupatorium adenophorum  | Ref. |
| Plantae | Asteraceae | Eupatorium macrocephalum Lee.  | Ref. |
| Plantae | Asteraceae | Gonospermum elegans | Ref. |
| Plantae | Asteraceae | Inula cappa  | Ref. |
| Plantae | Asteraceae | Inula racemosa  | Ref. |
| Plantae | Asteraceae | Inula viscosa  | Ref. |
| Plantae | Asteraceae | Robinsonecio gerberifolius | Ref. |
| Plantae | Asteraceae | Senecio chionophilus | Ref. |
| Plantae | Asteraceae | Taraxacum formosanum | Ref. |
| Plantae | Asteraceae | Viguiera decurrens | Ref. |
| Plantae | Balanophoraceae | Balanophora abbreviata B1 | Ref. |
| Plantae | Begoniaceae | Begonia nantoensis | Ref. |
| Plantae | Berberidaceae | Berberis pseudanubalata | Ref. |
| Plantae | Bignoniaceae | Newbouldia laevis  | Ref. |
| Plantae | Blechnaceae | Stenochlaena palustris | Ref. |
| Plantae | Canellaceae | Canella winterana  | Ref. |
| Plantae | Capparaceae | Capparis aegyptia  | Ref. |
| Plantae | Capparaceae | Capparis deserti | Ref. |
| Plantae | Capparaceae | Capparis leucophylla | Ref. |
| Plantae | Cecropiaceae | Myrianthus arboreus  | Ref. |
| Plantae | Celastraceae | Tripterygium wilfordii  | Ref. |
| Plantae | Clusiaceae/Clusiaceae-Guttiferae | Clusia nemorosa  | Ref. |
| Plantae | Clusiaceae/Clusiaceae-Guttiferae | Garcinia griffithii | Ref. |
| Plantae | Combretaceae | Combretum quadrangulare  | Ref. |
| Plantae | Connaraceae | Rourea minor  | Ref. |
| Plantae | Convallariaceae | Disporopsis aspera | Ref. |
| Plantae | Convolvulaceae | Erycibe expansa  | Ref. |
| Plantae | Convolvulaceae | Pharbitis nil  | Ref. |
| Plantae | Cruciferae | Raphanus sativus  | Ref. |
| Plantae | Cucurbitaceae | Gymnopetalum integrifolium  | Ref. |
| Plantae | Cupressaceae | Chamaecyparis formosensis | Ref. |
| Plantae | Dennstaedtiaceae | Pteridium aquilinum  | Ref. |
| Plantae | Dioscoreaceae | Dioscorea spongiosa | Ref. |
| Plantae | Dryopteridaceae | Dryopteris crassirhizoma | Ref. |
| Plantae | Ebenaceae | Diospyros rhodocalyx | Ref. |
| Plantae | Ephedraceae | Ephedra sinica  | Ref. |
| Plantae | Euphorbiaceae | Alchornea cordifolia  | Ref. |
| Plantae | Euphorbiaceae | Croton lechleri Mull.Arg.  | Ref. |
| Plantae | Euphorbiaceae | Croton urucurana Baill. | Ref. |
| Plantae | Euphorbiaceae | Euphorbia boetica | Ref. |
| Plantae | Euphorbiaceae | Euphorbia lanata | Ref. |
| Plantae | Euphorbiaceae | Euphorbia tinctoria  | Ref. |
| Plantae | Fabaceae | Cassia javanica  | Ref. |
| Plantae | Fabaceae | Centrosema pubescens | Ref. |
| Plantae | Fabaceae | Millettia conraui  | Ref. |
| Plantae | Fabaceae | Millettia pinnata | Ref. |
| Plantae | Fabaceae | Piptadenia macrocarpa | Ref. |
| Plantae | Fabaceae | Saraca asoca  | Ref. |
| Plantae | Fabaceae | Swartzia brachyrachis | Ref. |
| Plantae | Fabaceae | Trifolium resupinatum | Ref. |
| Plantae | Gentianaceae | Gentiana lutea L.  | Ref. |
| Plantae | Geraniaceae | Geranium macrorrhizum L.  | Ref. |
| Plantae | Geraniaceae | Pelargonium reniforme | Ref. |
| Plantae | Gnetaceae | Gnetum cleistostachyum | Ref. |
| Plantae | Gnetaceae | Gnetum pendulum C.Y. | Ref. |
| Plantae | Hydrangeaceae | Hydrangea chinensis | Ref. |
| Plantae | Hydrangeaceae | Pileostegia viburnoides var. glabrescens | Ref. |
| Plantae | Hydrocharitaceae | Enhalus acoroides | Ref. |
| Plantae | Hypoxidaceae | Curculigo capitulata | Ref. |
| Plantae | Labiatae | Callicarpa macrophylla  | Ref. |
| Plantae | Labiatae | Hyptis brevipes  | Ref. |
| Plantae | Labiatae | Isodon phyllostachys  | Ref. |
| Plantae | Labiatae | Salvia aethiopis | Ref. |
| Plantae | Labiatae | Salvia canariensis L. | Ref. |
| Plantae | Labiatae | Satureja acinos | Ref. |
| Plantae | Labiatae | Schnabelia tetradonta | Ref. |
| Plantae | Labiatae | Vitex trifolia  | Ref. |
| Plantae | Lauraceae | Beilschmiedia zenkeri | Ref. |
| Plantae | Lauraceae | Cinnamomum camphora  | Ref. |
| Plantae | Lauraceae | Machilus zuihoensis | Ref. |
| Plantae | Loranthaceae | Psittacanthus cucullaris | Ref. |
| Plantae | Lythraceae | Punica granatum  | Ref. |
| Plantae | Magnoliaceae | Magnolia obovata  | Ref. |
| Plantae | Malvaceae | Hibiscus taiwanensis | Ref. |
| Plantae | Melanthiaceae | Veratrum album  | Ref. |
| Plantae | Meliaceae | Aglaia rubiginosa | Ref. |
| Plantae | Meliaceae | Cipadessa cinerascens | Ref. |
| Plantae | Meliaceae | Khaya anthotheca | Ref. |
| Plantae | Meliaceae | Toona sinensis  | Ref. |
| Plantae | Meliaceae | Xylocarpus granatum  | Ref. |
| Plantae | Melianthaceae | Melianthus major  | Ref. |
| Plantae | Menispermaceae | Macrococculus pomiferus | Ref. |
| Plantae | Moraceae | Ficus septica | Ref. |
| Plantae | Moraceae | Morus insignis | Ref. |
| Plantae | Moringaceae | Moringa oleifera  | Ref. |
| Plantae | Moringaceae | Moringa peregrina  | Ref. |
| Plantae | Myrsinaceae | Embelia ribes Burm.  | Ref. |
| Plantae | Myrtaceae | Eucalyptus camaldulensis var.obtusa  | Ref. |
| Plantae | Myrtaceae | Eugenia sandwicensis | Ref. |
| Plantae | Myrtaceae | Psidium guajava  | Ref. |
| Plantae | Myrtaceae | Syzygium aromaticum  | Ref. |
| Plantae | Orchidaceae | Dendrobium nobile Lindl.  | Ref. |
| Plantae | Paeoniaceae | Paeonia suffruticosa  | Ref. |
| Plantae | Palmae | Borassus flabellifer  | Ref. |
| Plantae | Phyllanthaceae | Phyllanthus oligospermus | Ref. |
| Plantae | Picramniaceae | Picramnia latifolia | Ref. |
| Plantae | Piperaceae | Piper nigrum L.  | Ref. |
| Plantae | Piperaceae | Piper umbellatum  | Ref. |
| Plantae | Plumbaginaceae | Plumbago zeylanica  | Ref. |
| Plantae | Polygonaceae | Rumex nepalensis  | Ref. |
| Plantae | Primulaceae | Primula macrophylla | Ref. |
| Plantae | Pteridaceae | Pteris multifida  | Ref. |
| Plantae | Rosaceae | Chaenomeles japonica  | Ref. |
| Plantae | Rosaceae | Rubus ellipticus  | Ref. |
| Plantae | Rosaceae | Spiraea formosana  | Ref. |
| Plantae | Rubiaceae | Chione venosa (sw.) Urban var.venosa | Ref. |
| Plantae | Rubiaceae | Mitragyna inermis  | Ref. |
| Plantae | Rubiaceae | Mitragyna rotundifolia | Ref. |
| Plantae | Rubiaceae | Mitragyna speciosa | Ref. |
| Plantae | Rubiaceae | Mitragyna stipulosa  | Ref. |
| Plantae | Rubiaceae | Morinda citrifolia  | Ref. |
| Plantae | Rubiaceae | Morinda officinalis  | Ref. |
| Plantae | Rubiaceae | Ophiorrhiza liukiuensis | Ref. |
| Plantae | Rutaceae | Citrus reticulata  | Ref. |
| Plantae | Rutaceae | Zanthoxylum armatum  | Ref. |
| Plantae | Santalaceae | Viscum coloratum  | Ref. |
| Plantae | Schisandraceae | Kadsura heteroclita  | Ref. |
| Plantae | Scrophulariaceae | Scrophularia ningpoensis  | Ref. |
| Plantae | Smilacaceae | Smilax china  | Ref. |
| Plantae | Solanaceae | Hyoscyamus niger  | Ref. |
| Plantae | Solanaceae | Solanum melongena  | Ref. |
| Plantae | Solanaceae | Withania somnifera  | Ref. |
| Plantae | Stilbaceae | Nuxia sphaerocephala  | Ref. |
| Plantae | Taxaceae | Taxus wallichiana  | Ref. |
| Plantae | Trochodendraceae/Tetracentraceae | Tetracentron sinense  | Ref. |
| Plantae | Verbenaceae | Lantana camara  | Ref. |
| Plantae | Verbenaceae | Verbena brasiliensis VELL | Ref. |
| Plantae | Verbenaceae | Verbena officinalis  | Ref. |
| Plantae | Zingiberaceae | Alpinia blepharocalyx  | Ref. |
| Plantae | Zingiberaceae | Alpinia pinnanensis | Ref. |
| Plantae | Zingiberaceae | Zingiber aromaticum  | Ref. |
| Plantae | Zingiberaceae | Zingiber officinale  | Ref. |
| Plantae | Zygophyllaceae | Tribulus terrestris  | Ref. |
| - | - | Aceraceae nikoense | Ref. |
| - | - | Moghania macrophylla | Ref. |
|
|
zoom in
| Organism | Rumex nepalensis | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 3, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|