| Name |
Betulin |
| Formula |
C30H50O2 |
| Mw |
442.38108084 |
| CAS RN |
473-98-3 |
| C_ID |
C00003740
, 
|
| InChIKey |
FVWJYYTZTCVBKE-YYHFAXQKNA-N |
| InChICode |
InChI=1S/C30H50O2/c1-19(2)20-10-15-30(18-31)17-16-28(6)21(25(20)30)8-9-23-27(5)13-12-24(32)26(3,4)22(27)11-14-29(23,28)7/h20-25,31-32H,1,8-18H2,2-7H3/t20-,21+,22-,23+,24-,25+,27-,28+,29+,30+/m0/s1 |
| SMILES |
C=C(C)[C@@H]1CC[C@]2(CO)CC[C@]3(C)[C@H](CC[C@@H]4[C@@]5(C)CC[C@H](O)C(C)(C)[C@@H]5CC[C@]43C)[C@@H]12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Acanthaceae | Hypoestes purpurea | Ref. |
| Plantae | Acanthaceae | Phlogacanthus curviflorus | Ref. |
| Plantae | Acanthaceae | Strobilanthes cusia  | Ref. |
| Plantae | Acanthaceae | Strobilanthes formosanus | Ref. |
| Plantae | Adoxaceae | Sambucus williamsii | Ref. |
| Plantae | Apocynaceae | Nerium oleander  | Ref. |
| Plantae | Apocynaceae | Thevetia peruviana  | Ref. |
| Plantae | Asteraceae | Cichorium intybus  | Ref. |
| Plantae | Asteraceae | Saussurea lappa  | Ref. |
| Plantae | Betulaceae | Alnus oregana | Ref. |
| Plantae | Betulaceae | Betula alba | Ref. |
| Plantae | Betulaceae | Betula platyphylla | Ref. |
| Plantae | Betulaceae | Corylus avellana  | Ref. |
| Plantae | Boraginaceae | Arnebia hispidissima | Ref. |
| Plantae | Boraginaceae | Arnebia nobilis | Ref. |
| Plantae | Campanulaceae/Lobeliaceae | Platycodon grandiflorum  | Ref. |
| Plantae | Celastraceae | Maytenus chiapensis | Ref. |
| Plantae | Celastraceae | Maytenus cuzcoina | Ref. |
| Plantae | Combretaceae | Terminalia brasiliensis | Ref. |
| Plantae | Ebenaceae | Diospyros abyssinica  | Ref. |
| Plantae | Ebenaceae | Diospyros argentea | Ref. |
| Plantae | Ebenaceae | Diospyros bipindensis | Ref. |
| Plantae | Ebenaceae | Diospyros buxifolia  | Ref. |
| Plantae | Ebenaceae | Diospyros canaliculata | Ref. |
| Plantae | Ebenaceae | Diospyros candalleana | Ref. |
| Plantae | Ebenaceae | Diospyros castanea | Ref. |
| Plantae | Ebenaceae | Diospyros cauliflora | Ref. |
| Plantae | Ebenaceae | Diospyros chevalieri | Ref. |
| Plantae | Ebenaceae | Diospyros chloroxylon  | Ref. |
| Plantae | Ebenaceae | Diospyros cinnabarina | Ref. |
| Plantae | Ebenaceae | Diospyros consolatae | Ref. |
| Plantae | Ebenaceae | Diospyros crassiflora | Ref. |
| Plantae | Ebenaceae | Diospyros curranii | Ref. |
| Plantae | Ebenaceae | Diospyros dendo | Ref. |
| Plantae | Ebenaceae | Diospyros discolor  | Ref. |
| Plantae | Ebenaceae | Diospyros ebenum  | Ref. |
| Plantae | Ebenaceae | Diospyros elliptifolia | Ref. |
| Plantae | Ebenaceae | Diospyros embryopteris  | Ref. |
| Plantae | Ebenaceae | Diospyros eriantha | Ref. |
| Plantae | Ebenaceae | Diospyros evena | Ref. |
| Plantae | Ebenaceae | Diospyros exsculpta | Ref. |
| Plantae | Ebenaceae | Diospyros fragrans | Ref. |
| Plantae | Ebenaceae | Diospyros gabunensis | Ref. |
| Plantae | Ebenaceae | Diospyros gracilescens | Ref. |
| Plantae | Ebenaceae | Diospyros guianensis  | Ref. |
| Plantae | Ebenaceae | Diospyros hirsuta | Ref. |
| Plantae | Ebenaceae | Diospyros hoyleana | Ref. |
| Plantae | Ebenaceae | Diospyros ismailii | Ref. |
| Plantae | Ebenaceae | Diospyros iturensis | Ref. |
| Plantae | Ebenaceae | Diospyros kaki  | Ref. |
| Plantae | Ebenaceae | Diospyros kaki var.sylvestris  | Ref. |
| Plantae | Ebenaceae | Diospyros kamerunensis | Ref. |
| Plantae | Ebenaceae | Diospyros leucomelas | Ref. |
| Plantae | Ebenaceae | Diospyros longiflora | Ref. |
| Plantae | Ebenaceae | Diospyros lotus  | Ref. |
| Plantae | Ebenaceae | Diospyros maingayi | Ref. |
| Plantae | Ebenaceae | Diospyros malanonilau | Ref. |
| Plantae | Ebenaceae | Diospyros mannii | Ref. |
| Plantae | Ebenaceae | Diospyros maritima  | Ref. |
| Plantae | Ebenaceae | Diospyros melanoxylon  | Ref. |
| Plantae | Ebenaceae | Diospyros mespiliformis  | Ref. |
| Plantae | Ebenaceae | Diospyros monobuttensis | Ref. |
| Plantae | Ebenaceae | Diospyros montana  | Ref. |
| Plantae | Ebenaceae | Diospyros moonii | Ref. |
| Plantae | Ebenaceae | Diospyros morrisiana | Ref. |
| Plantae | Ebenaceae | Diospyros obliquifolia | Ref. |
| Plantae | Ebenaceae | Diospyros peregrina  | Ref. |
| Plantae | Ebenaceae | Diospyros pseudo-malabarica | Ref. |
| Plantae | Ebenaceae | Diospyros quaesita | Ref. |
| Plantae | Ebenaceae | Diospyros rhodocalyx | Ref. |
| Plantae | Ebenaceae | Diospyros sanza-minika | Ref. |
| Plantae | Ebenaceae | Diospyros siamang | Ref. |
| Plantae | Ebenaceae | Diospyros siamensis | Ref. |
| Plantae | Ebenaceae | Diospyros siderophylla | Ref. |
| Plantae | Ebenaceae | Diospyros singaporensis | Ref. |
| Plantae | Ebenaceae | Diospyros spinescens | Ref. |
| Plantae | Ebenaceae | Diospyros sumatrana | Ref. |
| Plantae | Ebenaceae | Diospyros sylvatica | Ref. |
| Plantae | Ebenaceae | Diospyros thwaitesii | Ref. |
| Plantae | Ebenaceae | Diospyros tomentosa  | Ref. |
| Plantae | Ebenaceae | Diospyros verrucosa | Ref. |
| Plantae | Ebenaceae | Diospyros virginiana  | Ref. |
| Plantae | Ebenaceae | Diospyros walkeri | Ref. |
| Plantae | Ebenaceae | Diospyros wallichii | Ref. |
| Plantae | Ebenaceae | Diospyros zenkeri | Ref. |
| Plantae | Ebenaceae | Euclea divinorum  | Ref. |
| Plantae | Ebenaceae | Euclea natalensis  | Ref. |
| Plantae | Ericaceae | Erica arborea L.  | Ref. |
| Plantae | Euphorbiaceae | Euphorbia lathyris  | Ref. |
| Plantae | Euphorbiaceae | Euphorbia paralias | Ref. |
| Plantae | Fabaceae | Acacia mellifera  | Ref. |
| Plantae | Fabaceae | Cassia siamea Lamk.  | Ref. |
| Plantae | Fabaceae | Dalbergia sericea | Ref. |
| Plantae | Fabaceae | Lespedeza bicolor  | Ref. |
| Plantae | Fabaceae | Pterocarpus santalinus  | Ref. |
| Plantae | Fabaceae | Vicia faba  | Ref. |
| Plantae | Juglandaceae | Juglans regia  | Ref. |
| Plantae | Labiatae | Origanum compactum  | Ref. |
| Plantae | Labiatae | Rosmarinus officinalis L.  | Ref. |
| Plantae | Labiatae | Salvia officinalis  | Ref. |
| Plantae | Lardizabalaceae | Stauntonia obovatifoliola Hayata subsp.intermedia | Ref. |
| Plantae | Lythraceae | Lawsonia alba  | Ref. |
| Plantae | Malpighiaceae | Byrsonima microphylla | Ref. |
| Plantae | Myrtaceae | Melaleuca ericifolia | Ref. |
| Plantae | Myrtaceae | Syzygium formosanum | Ref. |
| Plantae | Oleaceae | Jasminum lanceolarium | Ref. |
| Plantae | Oleaceae | Phillyrea latifolia L.  | Ref. |
| Plantae | Pelliaceae | Pellia epiphylla | Ref. |
| Plantae | Phyllanthaceae | Phyllanthus flexuosus | Ref. |
| Plantae | Phyllanthaceae | Phyllanthus urinaria  | Ref. |
| Plantae | Rhamnaceae | Ziziphus jujuba  | Ref. |
| Plantae | Rhamnaceae | Zizyphus vulgaris var.spinosus | Ref. |
| Plantae | Rhizophoraceae | Ceriops tagal  | Ref. |
| Plantae | Rosaceae | Chaenomeles sinensis KOEHNE  | Ref. |
| Plantae | Rubiaceae | Coussarea paniculata | Ref. |
| Plantae | Sapindaceae | Schleichera oleosa  | Ref. |
| Plantae | Trochodendraceae/Tetracentraceae | Tetracentron sinense  | Ref. |
| Plantae | Ulmaceae | Celtis philippinensis | Ref. |
| Plantae | Valerianaceae/Linnaeaceae/Dipsacaceae/Diervillaceae | Valeriana laxiflora | Ref. |
| - | - | Asteracantha longifolia  | Ref. |
| - | - | Befaria glutinosa | Ref. |
|
|
zoom in
| Organism | Valeriana laxiflora | | Reference | Gu, et al., Planta Med, 70, (2004), 509.
Yang, et al., Shenyang Yaoke Daxue Xuebao, 22, (2005), 449.
Yuan, et al., Journal of Natural Products, 68, (2005), 86.
Shen, et al., Journal of Natural Products, 67, (2004), 1947.
Tanaka, et al., Planta Med, 70, (2004), 1234.
Lee, et al., Planta Med, 70, (2004), 1119.
Mutai, et al., Phytochemistry, 65, (2004), 1159.
Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998).
Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999).
Yin, et al., Modern Study of Chinese Drugs and Clinical Applications (1), Xueyuan Press, Beijing, (1993).
Ji, et al., Pharmacological Action and Application of Available Antitumor Composition of Traditional Chinese Medicine, Heilongjiang Science and technology Press, Heilongjiang, (1998).
Edited by Jiangsu New Medicinal College, Chinese Medicine Dictionary, Shanghai Science and technology Press, Shanghai, (1979). |
|---|
|