| Name |
Gallic acid Gallate Gallic acid monohydrate |
| Formula |
C7H6O5 |
| Mw |
170.0215233 |
| CAS RN |
149-91-7 |
| C_ID |
C00002647
, 
|
| InChIKey |
LNTHITQWFMADLM-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C7H6O5/c8-4-1-3(7(11)12)2-5(9)6(4)10/h1-2,8-10H,(H,11,12) |
| SMILES |
O=C(O)c1cc(O)c(O)c(O)c1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Acanthaceae | Strobilanthes crispus  | Ref. |
| Plantae | Adoxaceae | Sambucus formosana | Ref. |
| Plantae | Alliaceae | Allium cepa  | Ref. |
| Plantae | Alliaceae | Allium sativum  | Ref. |
| Plantae | Alliaceae | Allium Sativum | Ref. |
| Plantae | Anacardiaceae | Choerospondias axillaris | Ref. |
| Plantae | Anacardiaceae | Cotinus coggygria | Ref. |
| Plantae | Anacardiaceae | Mangifera indica  | Ref. |
| Plantae | Anacardiaceae | Pistacia chinensis  | Ref. |
| Plantae | Anacardiaceae | Pistacia weinmannifolia J.Pisson ex.Franch  | Ref. |
| Plantae | Anacardiaceae | Rhus chinensis  | Ref. |
| Plantae | Anacardiaceae | Rhus coriaria  | Ref. |
| Plantae | Anacardiaceae | Rhus semialata  | Ref. |
| Plantae | Anacardiaceae | Rhus typhina  | Ref. |
| Plantae | Anacardiaceae | Rhus wallichi | Ref. |
| Plantae | Anacardiaceae | Semecarpus vitiensis | Ref. |
| Plantae | Annonaceae | Annona muricata  | Ref. |
| Plantae | Apiaceae | Foeniculum vulgare  | Ref. |
| Plantae | Apiaceae | Peucedanum praeruptorum | Ref. |
| Plantae | Apocynaceae | Catharanthus roseus  | Ref. |
| Plantae | Asteraceae | Matricaria chamomilla  | Ref. |
| Plantae | Asteraceae | Rhaponticum carthamoides  | Ref. |
| Plantae | Asteraceae | Tussilago farfara  | Ref. |
| Plantae | Balanophoraceae | Balanophora japonica | Ref. |
| Plantae | Bignoniaceae | Paratecoma peroba | Ref. |
| Plantae | Burseraceae | Boswellia dalzielii  | Ref. |
| Plantae | Burseraceae | Canarium album  | Ref. |
| Plantae | Calophyllaceae/Clusiaceae/Clusiaceae-Guttiferae | Calophyllum polyanthum | Ref. |
| Plantae | Cannabaceae | Humulus lupulus  | Ref. |
| Plantae | Caryophyllaceae | Dianthus caryophyllus  | Ref. |
| Plantae | Clusiaceae/Clusiaceae-Guttiferae | Garcinia densivenia | Ref. |
| Plantae | Clusiaceae-Guttiferae | Allanblackia floribunda  | Ref. |
| Plantae | Combretaceae | Combretum quadrangulare  | Ref. |
| Plantae | Combretaceae | Terminalia chebula  | Ref. |
| Plantae | Combretaceae | Terminalia fagifolia | Ref. |
| Plantae | Combretaceae | Terminalia superba  | Ref. |
| Plantae | Convolvulaceae | Pharbitis nil  | Ref. |
| Plantae | Coriariaceae | Coriaria sinica | Ref. |
| Plantae | Cornaceae/Aucubaceae/Garryaceae/Helwingiaceae | Cornus officinalis  | Ref. |
| Plantae | Crassulaceae | Rhodiola crenulata | Ref. |
| Plantae | Crassulaceae | Rhodiola kirilowii | Ref. |
| Plantae | Crassulaceae | Rhodiola rosea  | Ref. |
| Plantae | Crassulaceae | Rhodiola sachalinensis  | Ref. |
| Plantae | Crassulaceae | Sedum takesimense Nakai | Ref. |
| Plantae | Cruciferae | Raphanus sativus  | Ref. |
| Plantae | Cucurbitaceae | Citrullus colocynthis  | Ref. |
| Plantae | Cucurbitaceae | Lagenaria indica | Ref. |
| Plantae | Cucurbitaceae | Momordica charantia  | Ref. |
| Plantae | Cunoniaceae | Cunonia macrophylla | Ref. |
| Plantae | Cymodoceaceae | Amphibolis antarctica | Ref. |
| Plantae | Cymodoceaceae | Cymodocea rotundata | Ref. |
| Plantae | Cymodoceaceae | Cymodocea serrulata | Ref. |
| Plantae | Cymodoceaceae | Halodule uninervis | Ref. |
| Plantae | Cymodoceaceae | Thalassodendron ciliatum | Ref. |
| Plantae | Dilleniaceae | Dillenia indica  | Ref. |
| Plantae | Ebenaceae | Diospyros cinnabarina | Ref. |
| Plantae | Ebenaceae | Diospyros kaki  | Ref. |
| Plantae | Elaeagnaceae | Hippophae rhamnoides  | Ref. |
| Plantae | Ericaceae | Pyrola calliantha  | Ref. |
| Plantae | Euphorbiaceae | Croton tonkinensis GAGNEP | Ref. |
| Plantae | Euphorbiaceae | Euphorbia humifusa | Ref. |
| Plantae | Euphorbiaceae | Euphorbia lunulata  | Ref. |
| Plantae | Euphorbiaceae | Excoecaria cochinchinensis var.viridis  | Ref. |
| Plantae | Euphorbiaceae | Macaranga barteri | Ref. |
| Plantae | Euphorbiaceae | Mallotus furetianus | Ref. |
| Plantae | Euphorbiaceae | Sapium sebifenum | Ref. |
| Plantae | Euphorbiaceae | Sapium sebiferum  | Ref. |
| Plantae | Fabaceae | Abrus precatorius  | Ref. |
| Plantae | Fabaceae | Acacia arabica  | Ref. |
| Plantae | Fabaceae | Acacia cyanophylla | Ref. |
| Plantae | Fabaceae | Acacia farnesiana  | Ref. |
| Plantae | Fabaceae | Acacia horrida  | Ref. |
| Plantae | Fabaceae | Acacia longifolia | Ref. |
| Plantae | Fabaceae | Acacia mellifera  | Ref. |
| Plantae | Fabaceae | Acacia nilotica  | Ref. |
| Plantae | Fabaceae | Acacia polyacantha subsp.camphylacantha  | Ref. |
| Plantae | Fabaceae | Acacia saligna | Ref. |
| Plantae | Fabaceae | Acacia seyal  | Ref. |
| Plantae | Fabaceae | Acacia sieberiana  | Ref. |
| Plantae | Fabaceae | Acacia tortilis  | Ref. |
| Plantae | Fabaceae | Caesalpinia mimosoides  | Ref. |
| Plantae | Fabaceae | Caesalpinia pulcherrima  | Ref. |
| Plantae | Fabaceae | Caesalpinia sappan  | Ref. |
| Plantae | Fabaceae | Lupinus albus  | Ref. |
| Plantae | Fabaceae | Medicago sativa  | Ref. |
| Plantae | Fabaceae | Mucuna puriens | Ref. |
| Plantae | Fabaceae | Peltophorum africanum  | Ref. |
| Plantae | Fabaceae | Phaseolus vulgaris  | Ref. |
| Plantae | Fabaceae | Trifolium pratense  | Ref. |
| Plantae | Fabaceae | Trigonella foenum-graecum  | Ref. |
| Plantae | Fagaceae | Quercus alba  | Ref. |
| Plantae | Fagaceae | Quercus infectoria  | Ref. |
| Plantae | Fagaceae | Quercus robur  | Ref. |
| Plantae | Geraniaceae | Geranium macrorrhizum L.  | Ref. |
| Plantae | Geraniaceae | Geranium pratense | Ref. |
| Plantae | Geraniaceae | Geranium sibiricum  | Ref. |
| Plantae | Geraniaceae | Geranium thunbergii | Ref. |
| Plantae | Geraniaceae | Pelargonium reniforme | Ref. |
| Plantae | Geraniaceae | Pelargonium sidoides  | Ref. |
| Plantae | Ginkgoaceae | Ginkgo biloba  | Ref. |
| Plantae | Hamamelidaceae | Hamamelis virginiana  | Ref. |
| Plantae | Hamamelidaceae | Loropetalum chinense | Ref. |
| Plantae | Hydrocharitaceae | Enhalus acoroides | Ref. |
| Plantae | Hydrocharitaceae | Halophila minor | Ref. |
| Plantae | Hydrocharitaceae | Thalassia hemprichii | Ref. |
| Plantae | Iridaceae | Crocus sativus  | Ref. |
| Plantae | Juglandaceae | Juglans mandshurica | Ref. |
| Plantae | Juglandaceae | Juglans regia  | Ref. |
| Plantae | Juglandaceae | Platycarya strobilacea | Ref. |
| Plantae | Labiatae | Origanum acutidens | Ref. |
| Plantae | Labiatae | Origanum vulgare  | Ref. |
| Plantae | Labiatae | Salvia officinalis  | Ref. |
| Plantae | Labiatae | Thymus capitatus  | Ref. |
| Plantae | Loranthaceae | Psittacanthus cucullaris | Ref. |
| Plantae | Lythraceae | Lawsonia inermis  | Ref. |
| Plantae | Lythraceae | Lythrum salicaria  | Ref. |
| Plantae | Lythraceae | Punica granatum  | Ref. |
| Plantae | Malvaceae | Abutilon indicum  | Ref. |
| Plantae | Melastomataceae | Melastoma intermedium | Ref. |
| Plantae | Melastomataceae | Miconia cabucu | Ref. |
| Plantae | Melastomataceae | Miconia myriantha | Ref. |
| Plantae | Meliaceae | Azadirachta indica  | Ref. |
| Plantae | Meliaceae | Toona ciliata  | Ref. |
| Plantae | Meliaceae | Toona sinensis  | Ref. |
| Plantae | Moringaceae | Moringa oleifera  | Ref. |
| Plantae | Moringaceae | Moringa peregrina  | Ref. |
| Plantae | Moringaceae | Moringa peregrine | Ref. |
| Plantae | Moringaceae | Moringa stenopetala  | Ref. |
| Plantae | Myricaceae | Myrica rubra  | Ref. |
| Plantae | Myrsinaceae | Ardisia colorata | Ref. |
| Plantae | Myrtaceae | Eucalyptus robusta | Ref. |
| Plantae | Myrtaceae | Eugenia edulis  | Ref. |
| Plantae | Myrtaceae | Eugenia jambolana  | Ref. |
| Plantae | Myrtaceae | Eugenia sandwicensis | Ref. |
| Plantae | Myrtaceae | Pimenta dioica  | Ref. |
| Plantae | Myrtaceae | Psidium guajava  | Ref. |
| Plantae | Myrtaceae | Syzygium cordatum  | Ref. |
| Plantae | Myrtaceae | Syzygium cumini  | Ref. |
| Plantae | Nymphaeaceae | Nymphaea alba  | Ref. |
| Plantae | Nymphaeaceae | Nymphaea caerulea | Ref. |
| Plantae | Nymphaeaceae | Nymphaea stellata  | Ref. |
| Plantae | Onagraceae | Epilobium hirsutum  | Ref. |
| Plantae | Paeoniaceae | Paeonia albiflora  | Ref. |
| Plantae | Paeoniaceae | Paeonia emodi  | Ref. |
| Plantae | Paeoniaceae | Paeonia mouton | Ref. |
| Plantae | Palmae | Trachycarpus fortunei  | Ref. |
| Plantae | Passifloraceae | Passiflora caerulea  | Ref. |
| Plantae | Phyllanthaceae | Bridelia micrantha  | Ref. |
| Plantae | Phyllanthaceae | Emblica officinalis  | Ref. |
| Plantae | Phyllanthaceae | Phyllanthus emblica  | Ref. |
| Plantae | Phyllanthaceae | Phyllanthus niruri  | Ref. |
| Plantae | Phyllanthaceae | Phyllanthus urinaria  | Ref. |
| Plantae | Pinaceae | Picea abies  | Ref. |
| Plantae | Pinaceae | Pseudolarix kaempferi Gord.  | Ref. |
| Plantae | Poaceae | Triticum aestivum  | Ref. |
| Plantae | Polygonaceae | Eskemukerjea megacarpum HARA | Ref. |
| Plantae | Polygonaceae | Polygonum aviculare  | Ref. |
| Plantae | Polygonaceae | Polygonum bistorta  | Ref. |
| Plantae | Polygonaceae | Polygonum cuspidatum  | Ref. |
| Plantae | Polygonaceae | Polygonum equiseiforme | Ref. |
| Plantae | Polygonaceae | Polygonum hydropiper  | Ref. |
| Plantae | Polygonaceae | Polygonum multiflorum  | Ref. |
| Plantae | Polygonaceae | Polygonum orientale  | Ref. |
| Plantae | Polygonaceae | Rheum emodii | Ref. |
| Plantae | Polygonaceae | Rheum hotaoense | Ref. |
| Plantae | Polygonaceae | Rheum officinale  | Ref. |
| Plantae | Polygonaceae | Rheum palmatum  | Ref. |
| Plantae | Polygonaceae | Rheum tanguticum  | Ref. |
| Plantae | Polygonaceae | Rumex thyrsiflorus  | Ref. |
| Plantae | Posidoniaceae | Posidonia australis | Ref. |
| Plantae | Posidoniaceae | Posidonia oceanica  | Ref. |
| Plantae | Rosaceae | Agrimonia pilosa var.japonica  | Ref. |
| Plantae | Rosaceae | Cowania mexicana  | Ref. |
| Plantae | Rosaceae | Potentilla chinense | Ref. |
| Plantae | Rosaceae | Rosa chinensis  | Ref. |
| Plantae | Rosaceae | Rosa rugosa  | Ref. |
| Plantae | Rosaceae | Sanguisorba officinalis  | Ref. |
| Plantae | Rubiaceae | Uncaria gambir  | Ref. |
| Plantae | Sapindaceae | Acer rubrum L.  | Ref. |
| Plantae | Sapotaceae | Manilkara zapota cv.Tikal  | Ref. |
| Plantae | Sarcolaenaceae | Leptolaena diospyroidea | Ref. |
| Plantae | Sarcolaenaceae | Leptolaena pauciflora | Ref. |
| Plantae | Saxifragaceae | Saxifraga stolonifera  | Ref. |
| Plantae | Solanaceae | Capsicum annuum  | Ref. |
| Plantae | Solanaceae | Withania somnifera  | Ref. |
| Plantae | Tamaricaceae | Tamarix chinensis | Ref. |
| Plantae | Tamaricaceae | Tamarix nilotica | Ref. |
| Plantae | Taxaceae | Taxus baccata  | Ref. |
| Plantae | Theaceae | Camellia sinensis  | Ref. |
| Plantae | Turneraceae | Turnera ulmifolia  | Ref. |
| Plantae | Typhaceae | Typha domingensis P.  | Ref. |
| Plantae | Urticaceae | Debregeasia longifolia  | Ref. |
| Plantae | Valerianaceae/Linnaeaceae/Dipsacaceae/Diervillaceae | Valeriana officinalis  | Ref. |
| Plantae | Vitaceae | Ampelopsis japonica | Ref. |
| Plantae | Vitaceae | Vitis vinifera  | Ref. |
| Plantae | Zosteraceae | Phyllospadix scouleri | Ref. |
| Plantae | Zosteraceae | Phyllospadix serrulatus | Ref. |
| Plantae | Zosteraceae | Zostera capricorni | Ref. |
| Plantae | Zosteraceae | Zostera marina | Ref. |
| Plantae | Zosteraceae | Zostera muelleri | Ref. |
| - | - | Chamaenerion angustifolium | Ref. |
| - | - | Equsetum arvense | Ref. |
| - | - | FOOD SAKE | Ref. |
| - | - | Haematoxylon campechianum  | Ref. |
| - | - | Paraburkholderia phymatum | Ref. |
| - | - | Rohdiola sacra | Ref. |
| - | - | Sarcolaeana multiflora | Ref. |
| - | - | Terminala chebula | Ref. |
| - | - | terminalia bellirica | Ref. |
|
|
zoom in
| Organism | Thymus capitatus | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 4, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|