| Name |
Sophocarpine (-)-Sophocarpine |
| Formula |
C15H22N2O |
| Mw |
246.17321334 |
| CAS RN |
6483-15-4 |
| C_ID |
C00007759
, 
|
| InChIKey |
AAGFPTSOPGCENQ-JDDWTEENNA-N |
| InChICode |
InChI=1S/C15H22N2O/c18-14-7-1-6-13-12-5-3-9-16-8-2-4-11(15(12)16)10-17(13)14/h1,7,11-13,15H,2-6,8-10H2/t11-,12+,13+,15-/m0/s1 |
| SMILES |
O=C1C=CC[C@@H]2[C@H]3CCCN4CCC[C@@H](CN12)[C@@H]34 |
| Start Substs in Alk. Biosynthesis (Prediction) |
L-Pro L-Lys L-Arg L-Asp |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Berberidaceae | Leontice smirnovii | Ref. |
| Plantae | Daphniphyllaceae | Daphniphyllum oldhami | Ref. |
| Plantae | Fabaceae | Ammothamnus lehmanni Bge. | Ref. |
| Plantae | Fabaceae | Sophora alopecuroides | Ref. |
| Plantae | Fabaceae | Sophora flavescens  | Ref. |
| Plantae | Fabaceae | Sophora flavescens var. angustifolia  | Ref. |
| Plantae | Fabaceae | Sophora japonica L.  | Ref. |
| Plantae | Fabaceae | Sophora moorcroftiana Benth.  | Ref. |
| Plantae | Fabaceae | Sophora subprostrata | Ref. |
| Plantae | Fabaceae | Sophora viciifolia | Ref. |
| Plantae | Fabaceae | Vexibia pachycarpa | Ref. |
| Plantae | Fumariaceae | Corydalis yanhusuo  | Ref. |
|
|
zoom in
| Organism | Corydalis yanhusuo | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 1, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|