| Name |
Aloeresin Aloesin Aloe resin B |
| Formula |
C19H22O9 |
| Mw |
394.1263823 |
| CAS RN |
30861-27-9 |
| C_ID |
C00002415
, 
|
| InChIKey |
HKIKAXXIWJHWLY-CQDFSYGSNA-N |
| InChICode |
InChI=1S/C19H22O9/c1-7-3-10(22)14(19-17(26)16(25)15(24)12(6-20)28-19)18-13(7)11(23)5-9(27-18)4-8(2)21/h3,5,12,15-17,19-20,22,24-26H,4,6H2,1-2H3/t12-,15+,16+,17-,19+/m1/s1 |
| SMILES |
CC(=O)Cc1cc(=O)c2c(C)cc(O)c([C@@H]3OC(CO)[C@@H](O)[C@H](O)C3O)c2o1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asphodelaceae | Aloe arborescens  | Ref. |
| Plantae | Asphodelaceae | Aloe barbadensis  | Ref. |
| Plantae | Asphodelaceae | Aloe castanea | Ref. |
| Plantae | Asphodelaceae | Aloe elgonica | Ref. |
| Plantae | Asphodelaceae | Aloe ferox  | Ref. |
| Plantae | Asphodelaceae | Aloe marlothii  | Ref. |
| Plantae | Asphodelaceae | Aloe rupestris | Ref. |
| Plantae | Asphodelaceae | Aloe saponaria  | Ref. |
| Plantae | Asphodelaceae | Aloe spp.  | Ref. |
| Plantae | Asphodelaceae | Aloe striata | Ref. |
| Plantae | Asphodelaceae | Aloe vera  | Ref. |
| Plantae | Asphodelaceae | Aloe vera var. chinensis  | Ref. |
| Plantae | Polygonaceae | Rumex nepalensis  | Ref. |
|
|
zoom in
| Organism | Aloe vera var. chinensis | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 1, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|