| Name |
2-Phenylchromone Flavone |
| Formula |
C15H10O2 |
| Mw |
222.06807956 |
| CAS RN |
525-82-6 |
| C_ID |
C00001040
, 
|
| InChIKey |
VHBFFQKBGNRLFZ-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C15H10O2/c16-13-10-15(11-6-2-1-3-7-11)17-14-9-5-4-8-12(13)14/h1-10H |
| SMILES |
O=c1cc(-c2ccccc2)oc2ccccc12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Alliaceae | Allium sativum  | Ref. |
| Plantae | Annonaceae | Annona muricata  | Ref. |
| Plantae | Fabaceae | Medicago sativa  | Ref. |
| Plantae | Ginkgoaceae | Ginkgo biloba  | Ref. |
| Plantae | Labiatae | Salvia officinalis  | Ref. |
| Plantae | Myrtaceae | Acca sellowiana | Ref. |
| Plantae | Myrtaceae | Feijoa sellowiana  | Ref. |
| Plantae | Poaceae | Oryza sativa  | Ref. |
| Plantae | Primulaceae | Dionysia spp. | Ref. |
| Plantae | Primulaceae | Primula macrophylla | Ref. |
| Plantae | Primulaceae | Primula spp. | Ref. |
| Plantae | Rutaceae | Aegle marmelos  | Ref. |
| Plantae | Taxaceae | Taxus chinensis | Ref. |
| Plantae | Theaceae | Camellia sinensis  | Ref. |
| Plantae | Thymelaeaceae | Pimelea decora | Ref. |
| Plantae | Thymelaeaceae | Pimelea simplex | Ref. |
|
|
zoom in
| Organism | Aegle marmelos | | Reference | Singh, B and Sharma, R. A., Secondary Metabolites of Medicinal Plants, Vol. 1, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|