| Name |
Bergamotene Endo-bergamotene |
| Formula |
C15H24 |
| Mw |
204.18780077 |
| CAS RN |
6895-56-3 |
| C_ID |
C00052870
|
| InChIKey |
DGZBGCMPRYFWFF-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C15H24/c1-11(2)6-5-9-15(4)13-8-7-12(3)14(15)10-13/h6,13-14H,3,5,7-10H2,1-2,4H3 |
| SMILES |
C=C1CCC2CC1C2(C)CCC=C(C)C |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Apiaceae | Daucus carota  | Ref. |
| Plantae | Caricaceae | Carica papaya  | Ref. |
| Plantae | Labiatae | Ocimum basilicum  | Ref. |
| Plantae | Malvaceae | Gossypium hirsutum  | Ref. |
| Plantae | Polygonaceae | Polygonum minus | Ref. |
| Plantae | Rutaceae | Citrus aurantifolia  | Ref. |
| Plantae | Rutaceae | Citrus bergamia  | Ref. |
| Plantae | Rutaceae | Citrus medica  | Ref. |
| Plantae | Santalaceae | Santalum album  | Ref. |
| Plantae | Zingiberaceae | Curcuma longa  | Ref. |
| Plantae | Zingiberaceae | Zingiber officinale  | Ref. |
|
|
zoom in
| Organism | Zingiber officinale | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 4, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|