| Name |
D-germacrene Germacrene (+)-Germacrene A |
| Formula |
C15H24 |
| Mw |
204.18780077 |
| CAS RN |
28028-64-0 |
| C_ID |
C00036308
, 
|
| InChIKey |
XMRKUJJDDKYUHV-PFHCJLCBNA-N |
| InChICode |
InChI=1S/C15H24/c1-12(2)15-10-8-13(3)6-5-7-14(4)9-11-15/h6,9,15H,1,5,7-8,10-11H2,2-4H3/b13-6+,14-9+/t15-/m1/s1 |
| SMILES |
C=C(C)[C@H]1C/C=C(C)CC/C=C(C)CC1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Araliaceae | Panax ginseng  | Ref. |
| Plantae | Asteraceae | Barnadesia spinosa | Ref. |
| Plantae | Asteraceae | Eupatorium adenophorum  | Ref. |
| Plantae | Asteraceae | Saussurea lappa  | Ref. |
| Plantae | Jubulaceae | Frullania fragilifolia | Ref. |
| Plantae | Jubulaceae | Frullania tamarisci | Ref. |
| Plantae | Labiatae | Ocimum basilicum  | Ref. |
| Plantae | Labiatae | Thymus broussonetti | Ref. |
| Plantae | Labiatae | Thymus capitatus  | Ref. |
| Plantae | Labiatae | Thymus maroccanus | Ref. |
| Plantae | Labiatae | Thymus praecos | Ref. |
| Plantae | Lauraceae | Cinnamomum camphora  | Ref. |
| Plantae | Myrtaceae | Psidium guajava  | Ref. |
| Plantae | Pinaceae | Pinus sylvestris  | Ref. |
| Plantae | Rutaceae | Citrus aurantium  | Ref. |
| Plantae | Valerianaceae/Linnaeaceae/Dipsacaceae/Diervillaceae | Valeriana officinalis  | Ref. |
| Plantae | Zingiberaceae | Zingiber officinale  | Ref. |
|
|
zoom in
| Organism | Thymus praecos | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 4, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|