| Name |
Nepetin-7-glucoside Nepitrin 6-Methoxyluteolin 7-glucoside Nepetin 7-glucoside |
| Formula |
C22H22O12 |
| Mw |
478.11112617 |
| CAS RN |
569-90-4 |
| C_ID |
C00004400
, 
|
| InChIKey |
DMXHXBGUNHLMQO-JLXUOMDBNA-N |
| InChICode |
InChI=1S/C22H22O12/c1-31-21-14(33-22-20(30)19(29)17(27)15(7-23)34-22)6-13-16(18(21)28)11(26)5-12(32-13)8-2-3-9(24)10(25)4-8/h2-6,15,17,19-20,22-25,27-30H,7H2,1H3/t15-,17+,19-,20+,22+/m0/s1 |
| SMILES |
COc1c(O[C@@H]2OC(CO)[C@@H](O)[C@H](O)C2O)cc2oc(-c3ccc(O)c(O)c3)cc(=O)c2c1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Centaurea bracteata Scop. | Ref. |
| Plantae | Asteraceae | Inula britannica  | Ref. |
| Plantae | Labiatae | Nepeta hindostana  | Ref. |
| Plantae | Labiatae | Rosmarinus officinalis  | Ref. |
| Plantae | Labiatae | Salvia lavandulaefolia | Ref. |
| Plantae | Labiatae | Salvia plebeia  | Ref. |
| Plantae | Labiatae | Salvia tomentosa | Ref. |
| Plantae | Labiatae | Salvia triloba  | Ref. |
| Plantae | Plantaginaceae | Plantago major  | Ref. |
| Plantae | Scrophulariaceae | Scrophularia striata  | Ref. |
| Plantae | Scrophulariaceae | Scrophularia takesimensis | Ref. |
|
|
zoom in
| Organism | Scrophularia takesimensis | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 3, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|