| Name |
Littorine |
| Formula |
C17H23NO3 |
| Mw |
289.16779361 |
| CAS RN |
21956-47-8 |
| C_ID |
C00002295
, 
|
| InChIKey |
FNRXUEYLFZLOEZ-YIWWENMCNA-N |
| InChICode |
InChI=1S/C17H23NO3/c1-18-13-7-8-14(18)11-15(10-13)21-17(20)16(19)9-12-5-3-2-4-6-12/h2-6,13-16,19H,7-11H2,1H3/t13-,14+,15-,16-/m1/s1 |
| SMILES |
CN1C2CC[C@@H]1C[C@@H](OC(=O)[C@H](O)Cc1ccccc1)C2 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fumariaceae | Corydalis yanhusuo  | Ref. |
| Plantae | Solanaceae | Anisodus belladonna | Ref. |
| Plantae | Solanaceae | Anthocercis littorea | Ref. |
| Plantae | Solanaceae | Datura ceratocaula  | Ref. |
| Plantae | Solanaceae | Datura metel  | Ref. |
| Plantae | Solanaceae | Datura sanguinea | Ref. |
| Plantae | Solanaceae | Datura stramonium  | Ref. |
| Plantae | Solanaceae | Hyoscyamus albus  | Ref. |
| Plantae | Solanaceae | Hyoscyamus boveanus | Ref. |
| Plantae | Solanaceae | Hyoscyamus desertorum | Ref. |
| Plantae | Solanaceae | Hyoscyamus muticus  | Ref. |
| - | - | Anthoceris littorea | Ref. |
|
|
zoom in
| Organism | Hyoscyamus muticus | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 2, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|