| Name |
Vitamin B3 Nicotinic acid Niacin |
| Formula |
C6H5NO2 |
| Mw |
123.03202841 |
| CAS RN |
59-67-6 |
| C_ID |
C00000208
, 
|
| InChIKey |
PVNIIMVLHYAWGP-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C6H5NO2/c8-6(9)5-2-1-3-7-4-5/h1-4H,(H,8,9) |
| SMILES |
O=C(O)c1cccnc1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| -- | Bangiaceae | Porphyra tenera  | Ref. |
| Animalia | Bombycidae | Bombyx mori  | Ref. |
| Animalia | Bovidae | Bos taurus domesticus  | Ref. |
| Animalia | Hominidae | Homo sapiens (Serum) | Ref. |
| Bacteria | Enterobacteriaceae | Escherichia coli | Ref. |
| Fungi | Mortierellaceae | Mortierella vinacea | Ref. |
| Fungi | Trichocomaceae | Aspergillus fumigatus | Ref. |
| Plantae | Anacardiaceae | Mangifera indica  | Ref. |
| Plantae | Anemarrhenaceae | Anemarrhena asphodeloides  | Ref. |
| Plantae | Apiaceae | Angelica sinensis  | Ref. |
| Plantae | Araceae | Colocasia escultenta | Ref. |
| Plantae | Araliaceae | Panax ginseng  | Ref. |
| Plantae | Begoniaceae | Begonia nantoensis | Ref. |
| Plantae | Campanulaceae/Lobeliaceae | Codonopsis pilosula  | Ref. |
| Plantae | Cruciferae | Arabidopsis thaliana | Ref. |
| Plantae | Cruciferae | Brassica oleracea L. ssp. Botrytis  | Ref. |
| Plantae | Cucurbitaceae | Benincasa hispida  | Ref. |
| Plantae | Cyprinidae | Cyprinus carpio  | Ref. |
| Plantae | Dioscoreaceae | Dioscorea alata  | Ref. |
| Plantae | Fabaceae | Glycine max  | Ref. |
| Plantae | Fabaceae | Medicago sativa  | Ref. |
| Plantae | Fabaceae | Phaseolus vulgaris  | Ref. |
| Plantae | Fabaceae | Tamarindus indica  | Ref. |
| Plantae | Labiatae | Ajuga taiwanensis | Ref. |
| Plantae | Lauraceae | Cassytha filiformis  | Ref. |
| Plantae | Rhamnaceae | Ziziphus jujuba  | Ref. |
| Plantae | Solanaceae | Lycium chinense  | Ref. |
| Plantae | Solanaceae | Nicotiana tabacum  | Ref. |
| Plantae | Solanaceae | Solanum lycopersicum  | Ref. |
| - | - | Carpa hircus | Ref. |
| - | - | FOOD SAKE | Ref. |
| - | - | Gallus gallus domesticus  | Ref. |
|
|
zoom in
| Organism | Colocasia escultenta | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 1, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|