| Name |
Plicataloside |
| Formula |
C23H30O13 |
| Mw |
514.16864105 |
| CAS RN |
175889-42-6 |
| C_ID |
C00064037
|
| InChIKey |
OTUBYPWVGQENIK-OOOSPDQTSA-N |
| InChICode |
InChI=1S/C23H30O13/c1-8-5-9-3-2-4-10(33-22-19(31)17(29)14(26)11(6-24)34-22)13(9)16(28)21(8)36-23-20(32)18(30)15(27)12(7-25)35-23/h2-5,11-12,14-15,17-20,22-32H,6-7H2,1H3/t11-,12-,14-,15-,17+,18+,19-,20-,22-,23+/m1/s1 |
| SMILES |
Cc1cc2cccc(OC3OC(CO)C(O)C(O)C3O)c2c(O)c1OC1OC(CO)C(O)C(O)C1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asphodelaceae | Aloe barbadensis  | Ref. |
| Plantae | Asphodelaceae | Aloe ferox  | Ref. |
| Plantae | Asphodelaceae | Aloe harlans | Ref. |
| Plantae | Asphodelaceae | Aloe hildebrandtii | Ref. |
| Plantae | Asphodelaceae | Aloe plicatilis | Ref. |
|
|
zoom in
| Organism | Aloe ferox | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 1, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|