| Name |
Musizin-8-O-glucoside Nepodin-8-O-beta-D-glucopyranoside |
| Formula |
C19H22O8 |
| Mw |
378.13146768 |
| CAS RN |
100432-85-7 |
| C_ID |
C00063585
|
| InChIKey |
FZUPKYUANHOYBD-JZXZQAMYSA-N |
| InChICode |
InChI=1S/C19H22O8/c1-8-6-10-4-3-5-11(14(10)16(23)13(8)9(2)21)26-19-18(25)17(24)15(22)12(7-20)27-19/h3-6,12,15,17-20,22-25H,7H2,1-2H3/t12-,15-,17+,18-,19-/m1/s1 |
| SMILES |
CC(=O)c1c(C)cc2cccc(OC3OC(CO)C(O)C(O)C3O)c2c1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Polygonaceae | Rumex aquaticus  | Ref. |
| Plantae | Polygonaceae | Rumex patientia  | Ref. |
|
|
zoom in
| Organism | Rumex patientia | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 3, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|