| Name |
3beta-Isodihydrocadambine |
| Formula |
C27H34N2O10 |
| Mw |
546.22134532 |
| CAS RN |
62014-69-1 |
| C_ID |
C00050688
|
| InChIKey |
FCECVXQMCZMWDG-GLIUBSGJNA-N |
| InChICode |
InChI=1S/C27H34N2O10/c1-36-25(35)15-11-37-26(39-27-24(34)23(33)22(32)19(10-31)38-27)20-14(15)8-17-21-13(6-7-29(17)18(20)9-30)12-4-2-3-5-16(12)28-21/h2-5,11,14,17-20,22-24,26-28,30-34H,6-10H2,1H3/t14-,17-,18+,19-,20+,22-,23+,24-,26+,27+/m1/s1 |
| SMILES |
COC(=O)C1=CO[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H]2[C@@H]1C[C@@H]1c3[nH]c4ccccc4c3CCN1[C@H]2CO |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Rubiaceae | Uncaria rhynchophyllus | Ref. |
| Plantae | Rubiaceae | Uncaria sinensis  | Ref. |
|
|
zoom in
| Organism | Uncaria sinensis | | Reference | Yin, et al., Modern Study of Chinese Drugs and Clinical Applications (1), Xueyuan Press, Beijing, (1993).
Heitzman, et al., Phytochemistry, 66, (2005), 5 |
|---|
|