| Name |
Ancistroquinone C |
| Formula |
C13H12O5 |
| Mw |
248.06847349 |
| CAS RN |
35310-80-6 |
| C_ID |
C00033639
, 
|
| InChIKey |
OZNDFIHQPNQYAW-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C13H12O5/c1-6-10(14)7-4-5-8(17-2)13(18-3)9(7)12(16)11(6)15/h4-5,15H,1-3H3 |
| SMILES |
COc1ccc2c(c1OC)C(=O)C(O)=C(C)C2=O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Ancistrocladaceae | Ancistrocladus abbreviatus | Ref. |
| Plantae | Asphodelaceae | Aloe dawei  | Ref. |
|
|
zoom in
| Organism | Aloe dawei | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 1, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|