| Name |
Quinoline |
| Formula |
C9H7N |
| Mw |
129.05784923 |
| CAS RN |
91-22-5 |
| C_ID |
C00026478
, 
|
| InChIKey |
SMWDFEZZVXVKRB-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C9H7N/c1-2-6-9-8(4-1)5-3-7-10-9/h1-7H |
| SMILES |
c1ccc2ncccc2c1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
L-Trp Anthranilate L-Asp |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Cucurbitaceae | Citrullus colocynthis  | Ref. |
| Plantae | Fabaceae | Mucuna puriens | Ref. |
| Plantae | Labiatae | Mentha spp | Ref. |
| Plantae | Labiatae | Mentha spp.  | Ref. |
| Plantae | Rubiaceae | Cinchona ledgeriana | Ref. |
| Plantae | Rutaceae | Citrus aurantium  | Ref. |
| Plantae | Rutaceae | Galipea officnalis | Ref. |
| Plantae | Solanaceae | Nicotiana tabacum  | Ref. |
| - | - | Angostura trifoliata | Ref. |
| - | - | Oreophoetes peruana | Ref. |
|
|
zoom in
| Organism | Mucuna puriens | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 2, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|