| Name |
1-Methyl-4-methoxy-2-quinolone 4-Methoxy-1-methyl-2-quinolone N-Methyl-4-methoxycarbostyril |
| Formula |
C11H11NO2 |
| Mw |
189.0789786 |
| CAS RN |
32262-18-3 |
| C_ID |
C00026389
, 
|
| InChIKey |
SPBLFONLHXBBQE-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C11H11NO2/c1-12-9-6-4-3-5-8(9)10(14-2)7-11(12)13/h3-7H,1-2H3 |
| SMILES |
COc1cc(=O)n(C)c2ccccc12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
Anthranilate |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Fungi | Pyrenulaceae | Pyrenula japonica | Ref. |
| Plantae | Rutaceae | Aegle marmelos  | Ref. |
| Plantae | Rutaceae | Casimiroa edulis  | Ref. |
| Plantae | Rutaceae | Clausena lansium  | Ref. |
| Plantae | Rutaceae | Hesperethusa crenulata | Ref. |
| Plantae | Rutaceae | Ruta montana  | Ref. |
| Plantae | Rutaceae | Toddalia asiatica  | Ref. |
|
|
zoom in
| Organism | Aegle marmelos | | Reference | Singh, B and Sharma, R. A., Secondary Metabolites of Medicinal Plants, Vol. 1, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|