| Name |
Di-epi-alpha-cedrene alpha-Funebrene |
| Formula |
C15H24 |
| Mw |
204.18780077 |
| CAS RN |
50894-66-1 |
| C_ID |
C00021722
, 
|
| InChIKey |
IRAQOCYXUMOFCW-LQNFGWCTNA-N |
| InChICode |
InChI=1S/C15H24/c1-10-7-8-15-9-12(10)14(3,4)13(15)6-5-11(15)2/h7,11-13H,5-6,8-9H2,1-4H3/t11-,12-,13+,15-/m1/s1 |
| SMILES |
CC1=CC[C@]23C[C@H]1C(C)(C)[C@@H]2CC[C@H]3C |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Acoraceae | Acorus calanus L. | Ref. |
| Plantae | Asteraceae | Eupatorium adenophorum  | Ref. |
| Plantae | Asteraceae | Rhaponticum carthamoides  | Ref. |
| Plantae | Cupressaceae | Cupressus funebris Endl. | Ref. |
| Plantae | Cupressaceae | Thuja occidentalis  | Ref. |
| Plantae | Zingiberaceae | Curcuma longa  | Ref. |
| Plantae | Zingiberaceae | Curcuma wenyujin  | Ref. |
|
|
zoom in
| Organism | Eupatorium adenophorum | | Reference | Singh, B and Sharma, R. A., Secondary Metabolites of Medicinal Plants, Vol. 1, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|