| Name |
alpha-Elemene (+)-alpha-Elemene (-)-alpha-Elemene |
| Formula |
C15H24 |
| Mw |
204.18780077 |
| CAS RN |
5951-67-7 |
| C_ID |
C00012014
, 
|
| InChIKey |
QDUJKDRUFBJYSQ-GGYSOQFKNA-N |
| InChICode |
InChI=1S/C15H24/c1-7-15(6)9-8-13(11(2)3)10-14(15)12(4)5/h7,10,12H,1,8-9H2,2-6H3/t15-/m1/s1 |
| SMILES |
C=C[C@]1(C)CCC(=C(C)C)C=C1C(C)C |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Anacardiaceae | Mangifera indica  | Ref. |
| Plantae | Apiaceae | Petroselinum crispum  | Ref. |
| Plantae | Araliaceae | Panax ginseng  | Ref. |
| Plantae | Labiatae | Ocimum tenuiflorum  | Ref. |
| Plantae | Meliaceae | Dysoxylum fraseranum | Ref. |
| Plantae | Valerianaceae/Linnaeaceae/Dipsacaceae/Diervillaceae | Valeriana officinalis  | Ref. |
| Plantae | Zingiberaceae | Curcuma longa  | Ref. |
| Plantae | Zingiberaceae | Curcuma phaeocaulis  | Ref. |
|
|
zoom in
| Organism | Petroselinum crispum | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 3, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|