| Name |
Cytochalasin F Cytochalasin F6 |
| Formula |
C29H37NO5 |
| Mw |
479.2671733 |
| CAS RN |
36084-18-1 |
| C_ID |
C00011325
, 
|
| InChIKey |
CXWYFIYZAZBQGQ-VFTPFTMENA-N |
| InChICode |
InChI=1S/C29H37NO5/c1-18-9-7-13-21(31)15-16-24(32)34-29-22(14-8-10-18)26-28(3,35-26)19(2)25(29)23(30-27(29)33)17-20-11-5-4-6-12-20/h4-6,8,11-12,14-16,18-19,21-23,25-26,31H,7,9-10,13,17H2,1-3H3,(H,30,33)/b14-8+,16-15+/t18-,19+,21-,22+,23+,25+,26+,28-,29+/m1/s1 |
| SMILES |
C[C@H]1C/C=C/[C@H]2[C@@H]3O[C@]3(C)[C@@H](C)[C@H]3[C@H](Cc4ccccc4)NC(=O)[C@]32OC(=O)/C=C/[C@H](O)CCC1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
L-Trp L-Pro L-Asp IPP |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Fungi | Incertae sedis | Phoma exigua var.heteromorpha | Ref. |
| Fungi | Pleosporaceae | Helminthosporium dematioideum | Ref. |
| Fungi | Pleosporaceae | Pyrenophora semeniperda | Ref. |
|
|
zoom in
| Organism | Helminthosporium dematioideum | | Reference | Cole,Handbook of Secondary Fungal Metabolites,Volume I,(2003)
Cole,Handbook of Toxic Fungal Metabolites,(1981),286
Nator,Mycotoxins and Phytoalexins,(1991),291 |
|---|
|