| Name |
Linalyl oxide 2,6-Dimethyl-3,6-oxido-7-octen-2-ol |
| Formula |
C10H18O2 |
| Mw |
170.13067982 |
| CAS RN |
60047-17-8 |
| C_ID |
C00010335
, 
|
| InChIKey |
BRHDDEIRQPDPMG-MNLQIPBYNA-N |
| InChICode |
InChI=1S/C10H18O2/c1-5-10(4)7-6-8(12-10)9(2,3)11/h5,8,11H,1,6-7H2,2-4H3/t8-,10+/m1/s1 |
| SMILES |
C=C[C@@]1(C)CC[C@H](C(C)(C)O)O1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | -- | Lonicera japonica  | Ref. |
| Plantae | Cannabaceae | Cannabis sativa  | Ref. |
| Plantae | Geraniaceae | Pelargonium graveolens  | Ref. |
| Plantae | Oleaceae | Osmanthus fragrans  | Ref. |
| Plantae | Rosaceae | Eriobotrya japonica  | Ref. |
| Plantae | Rutaceae | Citrus paradis | Ref. |
| Plantae | Rutaceae | Citrus paradisi  | Ref. |
| Plantae | Theaceae | Thea sinensis  | Ref. |
|
|
zoom in
| Organism | Cannabis sativa | | Reference | Edited by Jiangsu New Medicinal College, Chinese Medicine Dictionary, Shanghai Science and technology Press, Shanghai, (1979).
Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999) |
|---|
|