| Name |
Naringenin 5-O-glucoside (S)-Naringenin-5-O-beta-D-glucoside Floribundoside Salipurposide |
| Formula |
C21H22O10 |
| Mw |
434.12129692 |
| CAS RN |
529-41-9 |
| C_ID |
C00008204
, 
|
| InChIKey |
MFQIWHVVFBCURA-FOUXOPOQNA-N |
| InChICode |
InChI=1S/C21H22O10/c22-8-16-18(26)19(27)20(28)21(31-16)30-15-6-11(24)5-14-17(15)12(25)7-13(29-14)9-1-3-10(23)4-2-9/h1-6,13,16,18-24,26-28H,7-8H2/t13-,16+,18+,19-,20+,21+/m0/s1 |
| SMILES |
O=C1CC(c2ccc(O)cc2)Oc2cc(O)cc(O[C@@H]3OC(CO)[C@@H](O)[C@H](O)C3O)c21 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Helichrysum spp. | Ref. |
| Plantae | Fabaceae | Acacia spp.  | Ref. |
| Plantae | Nymphaeaceae | Nymphaea caerulea | Ref. |
| Plantae | Poaceae | Oryza sativa  | Ref. |
| Plantae | Rosaceae | Prunus spp.  | Ref. |
| Plantae | Salicaceae | Salix daphnoides | Ref. |
| Plantae | Salicaceae | Salix purpurea  | Ref. |
| Plantae | Salicaceae | Salix spp. | Ref. |
| - | - | Persica vulgaris  | Ref. |
|
|
zoom in
| Organism | Acacia spp. | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 305,Flavanones and dihydroflavonols
Zemplen,Chem.Ber.,76,(1943),386
Cubucu,J.Nat.Prod.,45,(1982),137 |
|---|
|