| Name |
Cucurbitacin C |
| Formula |
C32H48O8 |
| Mw |
560.33491851 |
| CAS RN |
5988-76-1 |
| C_ID |
C00003684
, 
|
| InChIKey |
DGIGXLXLGBAJJN-KYGGLZRENA-N |
| InChICode |
InChI=1S/C32H48O8/c1-18(34)40-27(2,3)14-13-24(37)31(8,39)26-21(35)15-29(6)22-11-9-19-20(10-12-23(36)28(19,4)5)32(22,17-33)25(38)16-30(26,29)7/h9,13-14,20-23,26,33,35-36,39H,10-12,15-17H2,1-8H3/b14-13+/t20-,21-,22+,23+,26+,29+,30-,31+,32+/m1/s1 |
| SMILES |
CC(=O)OC(C)(C)/C=C/C(=O)[C@](C)(O)[C@H]1[C@H](O)C[C@@]2(C)[C@@H]3CC=C4[C@@H](CC[C@H](O)C4(C)C)[C@]3(CO)C(=O)C[C@]12C |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Cucurbitaceae | Bryonia alba  | Ref. |
| Plantae | Cucurbitaceae | Citrullus colocynthis  | Ref. |
| Plantae | Cucurbitaceae | Cucumis sativus  | Ref. |
|
|
zoom in
| Organism | Citrullus colocynthis | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 1, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|