| Name |
Ziganein-5-methyl ether |
| Formula |
C16H12O4 |
| Mw |
268.07355887 |
| CAS RN |
76695-93-7 |
| C_ID |
C00064532
|
| InChIKey |
RFURGWSMUIAQQO-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C16H12O4/c1-8-6-10-13(11(17)7-8)15(18)9-4-3-5-12(20-2)14(9)16(10)19/h3-7,17H,1-2H3 |
| SMILES |
COc1cccc2c1C(=O)c1cc(C)cc(O)c1C2=O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asphodelaceae | Aloe barbadensis  | Ref. |
| Plantae | Asphodelaceae | Aloe sabaea | Ref. |
| Plantae | Asphodelaceae | Aloe saponaria | Ref. |
| Plantae | Asphodelaceae | Aloe vera | Ref. |
|
|
zoom in
| Organism | Aloe barbadensis |
|---|
| Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 1, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|
