| Name |
Aloesaponol IV |
| Formula |
C16H16O5 |
| Mw |
288.09977362 |
| CAS RN |
65317-05-7 |
| C_ID |
C00064465
|
| InChIKey |
SWCFDBZAIAAHRG-XWJGPBAUNA-N |
| InChICode |
InChI=1/C16H16O5/c1-7-3-8-5-9-10(17)6-12(21-2)15(19)14(9)16(20)13(8)11(18)4-7/h3-5,10,12,17-18,20H,6H2,1-2H3/t10-,12+/s2 |
| SMILES |
COC1CC(O)c2cc3cc(C)cc(O)c3c(O)c2C1=O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asphodelaceae | Aloe barbadensis  | Ref. |
| Plantae | Asphodelaceae | Aloe saponaria  | Ref. |
|
|
zoom in
| Organism | Aloe barbadensis | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 1, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|