| Name |
Feroxidin |
| Formula |
C11H14O3 |
| Mw |
194.09429431 |
| CAS RN |
129622-85-1 |
| C_ID |
C00063763
|
| InChIKey |
WEHCLKPVYGSJHR-HTRCEHHLSA-N |
| InChICode |
InChI=1S/C11H14O3/c1-6-2-8(12)3-7-4-9(13)5-10(14)11(6)7/h4-6,8,12-14H,2-3H2,1H3/t6-,8-/m1/s1 |
| SMILES |
CC1CC(O)Cc2cc(O)cc(O)c21 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asphodelaceae | Aloe barbadensis  | Ref. |
| Plantae | Asphodelaceae | Aloe ferox  | Ref. |
| Plantae | Asphodelaceae | Aloe harlans | Ref. |
| Plantae | Asphodelaceae | Aloe hildebrandtii | Ref. |
|
|
zoom in
| Organism | Aloe barbadensis | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 1, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|