| Name |
1-Hydroxynaphthalene 1-Naphthalenol |
| Formula |
C10H8O |
| Mw |
144.05751488 |
| CAS RN |
90-15-3 |
| C_ID |
C00063316
|
| InChIKey |
KJCVRFUGPWSIIH-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C10H8O/c11-10-7-3-5-8-4-1-2-6-9(8)10/h1-7,11H |
| SMILES |
Oc1cccc2ccccc12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Acanthaceae | Strobilanthes crispus  | Ref. |
| Plantae | Asteraceae | Eupatorium adenophorum  | Ref. |
| Plantae | Magnoliaceae | Magnolia liliiflora  | Ref. |
|
|
zoom in
| Organism | Strobilanthes crispus | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 3, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|