| Name |
Cymene Cymol |
| Formula |
C10H14 |
| Mw |
134.10955045 |
| CAS RN |
25155-15-1 |
| C_ID |
C00061079
|
| InChIKey |
WWRCMNKATXZARA-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C10H14/c1-8(2)10-7-5-4-6-9(10)3/h4-8H,1-3H3 |
| SMILES |
Cc1ccccc1C(C)C |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Eupatorium adenophorum  | Ref. |
| Plantae | Cistaceae | Cistus creticus | Ref. |
| Plantae | Labiatae | Rosmarinus officinalis  | Ref. |
| Plantae | Saururaceae | Houttuynia cordata  | Ref. |
| Plantae | Solanaceae | Solanum lycopersicum  | Ref. |
|
|
zoom in
| Organism | Eupatorium adenophorum | | Reference | Singh, B and Sharma, R. A., Secondary Metabolites of Medicinal Plants, Vol. 1, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|