| Name |
7-Acetyl-8-hydroxy-2-methoxy-6-methyl-1,4-naphthoquinone Orientalone |
| Formula |
C14H12O5 |
| Mw |
260.06847349 |
| CAS RN |
64756-97-4 |
| C_ID |
C00055261
|
| InChIKey |
RRQIDDGRIQVTGM-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C14H12O5/c1-6-4-8-9(16)5-10(19-3)13(17)12(8)14(18)11(6)7(2)15/h4-5,18H,1-3H3 |
| SMILES |
COC1=CC(=O)c2cc(C)c(C(C)=O)c(O)c2C1=O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Polygonaceae | Rumex nepalensis  | Ref. |
| Plantae | Rosaceae | Prunus cerasoides  | Ref. |
|
|
zoom in
| Organism | Rumex nepalensis | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 3, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|