| Name |
2-Methylquinoline Quinaldine |
| Formula |
C10H9N |
| Mw |
143.07349929 |
| CAS RN |
91-63-4 |
| C_ID |
C00052398
|
| InChIKey |
SMUQFGGVLNAIOZ-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C10H9N/c1-8-6-7-9-4-2-3-5-10(9)11-8/h2-7H,1H3 |
| SMILES |
Cc1ccc2ccccc2n1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Cucurbitaceae | Citrullus colocynthis  | Ref. |
| Plantae | Nitrariaceae | Peganum harmala  | Ref. |
| Plantae | Rutaceae | Galipea officnalis | Ref. |
| - | - | Angostura trifoliata | Ref. |
| - | - | Copenatus mesoleucus | Ref. |
|
|
zoom in
| Organism | Citrullus colocynthis | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 1, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|