| Name |
Montanic acid Octacosanoic acid |
| Formula |
C28H56O2 |
| Mw |
424.42803103 |
| CAS RN |
506-48-9 |
| C_ID |
C00051638
|
| InChIKey |
GVQVQDJGCZWMMK-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C28H56O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-24-25-26-27-28(29)30/h2-27H2,1H3,(H,29,30) |
| SMILES |
CCCCCCCCCCCCCCCCCCCCCCCCCCCOC=O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Artemisia roxbugiana | Ref. |
| Plantae | Asteraceae | Eupatorium adenophorum  | Ref. |
| Plantae | Cruciferae | Arabidopsis thaliana | Ref. |
| Plantae | Cucurbitaceae | Trichosanthes rosthornii  | Ref. |
| Plantae | Ginkgoaceae | Ginkgo biloba  | Ref. |
| Plantae | Poaceae | Triticum aestivum  | Ref. |
| Plantae | Solanaceae | Solanum tuberosum  | Ref. |
|
|
zoom in
| Organism | Artemisia roxbugiana | | Reference | Yin, et al., Modern Study of Chinese Drugs and Clinical Applications (1), Xueyuan Press, Beijing, (1993).
Hu, et al., China Journal of Chinese Materia Medica(Zhongguo Zhongyao Zazhi), 19, (1994), 164.
Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999) |
|---|
|