| Name |
Lathyrol-3,15-diacetate-5-benzoate |
| Formula |
C31H38O7 |
| Mw |
522.26175357 |
| CAS RN |
218916-52-0 |
| C_ID |
C00051212
|
| InChIKey |
JPYYWXPAHJBKJX-BTSFZWMHNA-N |
| InChICode |
|
| SMILES |
C=C1CC[C@H]2[C@H](/C=C(C)C(=O)[C@@]3(OC(C)=O)C[C@@H](C)[C@@H](OC(=O)c4ccccc4)[C@@H]3[C@H]1OC(C)=O)C2(C)C |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Euphorbiaceae | Euphorbia lathyris  | Ref. |
|
|
zoom in
| Organism | Euphorbia lathyris | | Reference | Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999) |
|---|
|