| Name |
Junosmarin Campestrol |
| Formula |
C19H22O6 |
| Mw |
346.14163844 |
| CAS RN |
85165-97-5 |
| C_ID |
C00051087
|
| InChIKey |
GWZZKJQYTUFZHD-PWQNQZOANA-N |
| InChICode |
InChI=1S/C19H22O6/c1-10(2)9-14(21)24-18-16(22)15-12(25-19(18,3)4)7-5-11-6-8-13(20)23-17(11)15/h5-8,10,16,18,22H,9H2,1-4H3/t16-,18+/m0/s1 |
| SMILES |
CC(C)CC(=O)O[C@@H]1[C@@H](O)c2c(ccc3ccc(=O)oc23)OC1(C)C |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Ranunculaceae | Nigella sativa  | Ref. |
| Plantae | Rutaceae | Citrus junos  | Ref. |
| Plantae | Rutaceae | Citrus medica var.etrog  | Ref. |
| Plantae | Rutaceae | Citrus tachibana | Ref. |
|
|
zoom in
| Organism | Nigella sativa | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 2, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|