| Name |
Isorhynchophyllic acid |
| Formula |
C21H26N2O4 |
| Mw |
370.18925733 |
| CAS RN |
144525-05-3 |
| C_ID |
C00050989
|
| InChIKey |
HPMMQWZOBMYITQ-WMMOLIKWNA-N |
| InChICode |
InChI=1S/C21H26N2O4/c1-3-13-11-23-9-8-21(16-6-4-5-7-17(16)22-20(21)26)18(23)10-14(13)15(12-27-2)19(24)25/h4-7,12-14,18H,3,8-11H2,1-2H3,(H,22,26)(H,24,25)/b15-12+/t13-,14-,18-,21-/m0/s1 |
| SMILES |
CC[C@H]1CN2CC[C@@]3(C(=O)Nc4ccccc43)[C@@H]2CC1/C(=COC)OC=O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Rubiaceae | Uncaria sinensis  | Ref. |
|
|
zoom in
| Organism | Uncaria sinensis |
|---|
| Reference | Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999).
Heitzman, et al., Phytochemistry, 66, (2005), 5 |
|---|
|
