| Name |
Isopteropodic acid |
| Formula |
C20H22N2O4 |
| Mw |
354.15795721 |
| CAS RN |
13897-74-0 |
| C_ID |
C00050984
|
| InChIKey |
UEDNQGTWLLJZBV-XNBSKOECNA-N |
| InChICode |
InChI=1S/C20H22N2O4/c1-11-13-9-22-7-6-20(15-4-2-3-5-16(15)21-19(20)25)17(22)8-12(13)14(10-26-11)18(23)24/h2-5,10-13,17H,6-9H2,1H3,(H,21,25)(H,23,24)/t11-,12-,13-,17-,20-/m0/s1 |
| SMILES |
C[C@@H]1OC=C(OC=O)[C@H]2C[C@@H]3N(CC[C@@]34C(=O)Nc3ccccc34)C[C@@H]12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Rubiaceae | Uncaria sinensis  | Ref. |
|
|
zoom in
| Organism | Uncaria sinensis | | Reference | Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999).
Heitzman, et al., Phytochemistry, 66, (2005), 5 |
|---|
|