| Name |
Isodelphinine 3,13-Dideoxymesaconitine |
| Formula |
C33H45NO9 |
| Mw |
599.30943204 |
| CAS RN |
1357-96-6 |
| C_ID |
C00050903
|
| InChIKey |
MYVIYJCHYUIXLX-VFYSIUQVNA-N |
| InChICode |
InChI=1S/C33H45NO9/c1-17(35)43-33-22-20(14-19(25(40-5)29(33)36)24(22)42-30(37)18-10-8-7-9-11-18)32-21(39-4)12-13-31(16-38-3)15-34(2)28(32)23(33)26(41-6)27(31)32/h7-11,19-29,36H,12-16H2,1-6H3/t19-,20+,21-,22+,23-,24-,25+,26-,27+,28+,29-,31-,32-,33+/m0/s1 |
| SMILES |
COC[C@@]12CC[C@H](OC)C34C(C([C@H](OC)[C@@H]31)[C@]1(OC(C)=O)[C@H]3[C@@H](OC(=O)c5ccccc5)[C@H](C[C@H]34)[C@@H](OC)[C@@H]1O)N(C)C2 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Ranunculaceae | Aconitum carmichaeli  | Ref. |
|
|
zoom in
| Organism | Aconitum carmichaeli | | Reference | Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999) |
|---|
|