| Name |
Jolkinol B |
| Formula |
C29H36O5 |
| Mw |
464.25627426 |
| CAS RN |
62820-12-6 |
| C_ID |
C00047941
, 
|
| InChIKey |
OMBNGHNNZSKBRK-GFVMPMKXNA-N |
| InChICode |
InChI=1S/C29H36O5/c1-17-15-21-20(27(21,3)4)13-14-28(5)26(34-28)23-24(31)18(2)16-29(23,25(17)32)33-22(30)12-11-19-9-7-6-8-10-19/h6-12,15,18,20-21,23-24,26,31H,13-14,16H2,1-5H3/b12-11+,17-15-/t18-,20+,21+,23-,24-,26-,28-,29+/m0/s1 |
| SMILES |
C/C1=C/C2C(CCC3(C)OC3C3C(O)C(C)CC3(OC(=O)/C=C/c3ccccc3)C1=O)C2(C)C |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Euphorbiaceae | Euphorbia jolkini | Ref. |
| Plantae | Euphorbiaceae | Euphorbia lathyris  | Ref. |
| Plantae | Euphorbiaceae | Euphorbia micractina | Ref. |
| Plantae | Euphorbiaceae | Euphorbia wallichii  | Ref. |
|
|
zoom in
| Organism | Euphorbia jolkini | | Reference | Buckingham(Executive Editor), Dictionary of Natural Products, Chapman & Hall, 1994, Vol1-7
1995, Vol8
1996, Vol9
1997, Vol10
1998, Vol11.
Wang, et al., Chinese Traditional and Herbal Drugs(Zhongcaoyao), 35, (2004), 611 |
|---|
|