| Name |
2-Hydroxyquinoline 2-Quinolone |
| Formula |
C9H7NO |
| Mw |
145.05276385 |
| CAS RN |
59-31-4 |
| C_ID |
C00044432
, 
|
| InChIKey |
LISFMEBWQUVKPJ-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C9H7NO/c11-9-6-5-7-3-1-2-4-8(7)10-9/h1-6H,(H,10,11) |
| SMILES |
O=c1ccc2ccccc2[nH]1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
Anthranilate |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Cucurbitaceae | Citrullus colocynthis  | Ref. |
| Plantae | Rutaceae | Glycosmis arborea | Ref. |
|
|
zoom in
| Organism | Citrullus colocynthis | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 1, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|