| Name |
Mavacurine |
| Formula |
C20H25N2O |
| Mw |
309.19668843 |
| CAS RN |
6801-19-0 |
| C_ID |
C00037485
, 
|
| InChIKey |
HFLUPWJGJPYITM-QLKAYGNNNA-N |
| InChICode |
InChI=1S/C20H25N2O/c1-3-13-11-22(2)9-8-15-14-6-4-5-7-17(14)21-18(12-23)16(13)10-19(22)20(15)21/h3-7,16,18-19,23H,8-12H2,1-2H3/q+1/b13-3+/t16-,18-,19-,22-/m1/s1 |
| SMILES |
C/C=C1C[N+]2(C)CCc3c4n(c5ccccc35)C(CO)C1CC42 |
| Start Substs in Alk. Biosynthesis (Prediction) |
L-Trp Secologanin IPP |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Longaniaceae | Strychnos amazonica | Ref. |
| Plantae | Longaniaceae | Strychnos divaricans | Ref. |
| Plantae | Longaniaceae | Strychnos guianensis  | Ref. |
| Plantae | Longaniaceae | Strychnos mittschelichii | Ref. |
| Plantae | Longaniaceae | Strychnos nux-vomica  | Ref. |
| Plantae | Longaniaceae | Strychnos toxifera  | Ref. |
|
|
zoom in
| Organism | Strychnos amazonica | | Reference | Edited by Jiangsu New Medicinal College, Chinese Medicine Dictionary, Shanghai Science and technology Press, Shanghai, (1979).
Buckingham(Executive Editor), Dictionary of Natural Products, Chapman & Hall, 1994, Vol1-7
1995, Vol8
1996, Vol9
1997, Vol10
1998, Vol11 |
|---|
|