| Name |
Aloin B Isobarbaloin |
| Formula |
C21H22O9 |
| Mw |
418.1263823 |
| CAS RN |
28371-16-6 |
| C_ID |
C00036708
, 
|
| InChIKey |
AFHJQYHRLPMKHU-PYNDDRRPNA-N |
| InChICode |
InChI=1S/C21H22O9/c22-6-8-4-10-14(21-20(29)19(28)17(26)13(7-23)30-21)9-2-1-3-11(24)15(9)18(27)16(10)12(25)5-8/h1-5,13-14,17,19-26,28-29H,6-7H2/t13-,14-,17-,19-,20+,21+/m1/s1 |
| SMILES |
O=C1c2c(O)cccc2[C@@H]([C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)c2cc(CO)cc(O)c21 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asphodelaceae | Aloe arborescens  | Ref. |
| Plantae | Asphodelaceae | Aloe barbadensis  | Ref. |
| Plantae | Asphodelaceae | Aloe boylei | Ref. |
| Plantae | Asphodelaceae | Aloe castanea | Ref. |
| Plantae | Asphodelaceae | Aloe marlothii  | Ref. |
| Plantae | Asphodelaceae | Aloe spp.  | Ref. |
| Plantae | Asphodelaceae | Aloe striata | Ref. |
| Plantae | Asphodelaceae | Aloe vera var. chinensis  | Ref. |
|
|
zoom in
| Organism | Aloe arborescens | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 1, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|