| Name |
Aurantiamide acetate Aurantiamideacetate |
| Formula |
C27H28N2O4 |
| Mw |
444.2049074 |
| CAS RN |
56121-42-7 |
| C_ID |
C00020778
, 
|
| InChIKey |
VZPAURMDJZOGHU-UHFFFAOYNA-N |
| InChICode |
InChI=1S/C27H28N2O4/c1-20(30)33-19-24(17-21-11-5-2-6-12-21)28-27(32)25(18-22-13-7-3-8-14-22)29-26(31)23-15-9-4-10-16-23/h2-16,24-25H,17-19H2,1H3,(H,28,32)(H,29,31)/t24-,25+/m0/s1 |
| SMILES |
CC(=O)OCC(Cc1ccccc1)NC(=O)C(Cc1ccccc1)NC(=O)c1ccccc1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
L-Arg L-Asp L-Phe |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Ageratina conyzoides | Ref. |
| Plantae | Asteraceae | Artemisia annua  | Ref. |
| Plantae | Celastraceae | Tripterygium wilfordii  | Ref. |
| Plantae | Euphorbiaceae | Croton hieronymi  | Ref. |
| Plantae | Fabaceae | Millettia pinnata | Ref. |
| Plantae | Labiatae | Orthosiphon stamineus  | Ref. |
| Plantae | Polygonaceae | Polygonum chinensis L. | Ref. |
| Plantae | Rosaceae | Spiraea formosana  | Ref. |
| Plantae | Simaroubaceae | Pierreodendron kerstingii Little. | Ref. |
| Plantae | Zygophyllaceae | Tribulus terrestris  | Ref. |
| - | - | Acanthophora spicifera | Ref. |
|
|
zoom in
| Organism | Ageratina conyzoides | | Reference | Singh, B and Sharma, R. A., Secondary Metabolites of Medicinal Plants, Vol. 1, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|