| Name |
Cytochalasin G |
| Formula |
C29H34N2O4 |
| Mw |
474.25185759 |
| CAS RN |
70852-29-8 |
| C_ID |
C00011356
, 
|
| InChIKey |
YGKUXRWMCOUTAL-UPKPDBFKNA-N |
| InChICode |
InChI=1S/C29H34N2O4/c1-16-7-6-9-21-26-28(3,35-26)17(2)25-23(14-18-15-30-22-10-5-4-8-20(18)22)31-27(34)29(21,25)24(33)12-11-19(32)13-16/h4-6,8-10,15-17,21,23,25-26,30H,7,11-14H2,1-3H3,(H,31,34)/b9-6+/t16-,17-,21-,23-,25-,26-,28+,29-/m0/s1 |
| SMILES |
C[C@H]1C/C=C/[C@H]2[C@@H]3O[C@]3(C)[C@@H](C)[C@H]3C(Cc4c[nH]c5ccccc45)NC(=O)[C@]32C(=O)CCC(=O)C1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
L-Trp IPP |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Fungi | Pseudeurotiaceae | Pseudeurotium zonatum | Ref. |
| Plantae | Nigrosabulum | Nigrosabulum spp. | Ref. |
| - | - | Pseuderotium zonatum | Ref. |
|
|
zoom in
| Organism | Pseudeurotium zonatum | | Reference | Cole,Handbook of Secondary Fungal Metabolites,Volume I,(2003)
Cole,Handbook of Toxic Fungal Metabolites,(1981),272
Nator,Mycotoxins and Phytoalexins,(1991),291 |
|---|
|