| Name |
Rugulovasine B |
| Formula |
C16H16N2O2 |
| Mw |
268.12117777 |
| CAS RN |
26909-34-2 |
| C_ID |
C00011244
, 
|
| InChIKey |
QTWQJTORJVFWAQ-AYSIPDSENA-N |
| InChICode |
InChI=1S/C16H16N2O2/c1-9-7-16(20-15(9)19)11-4-3-5-12-14(11)10(8-18-12)6-13(16)17-2/h3-5,7-8,13,17-18H,6H2,1-2H3/t13-,16-/m0/s1 |
| SMILES |
CN[C@H]1Cc2c[nH]c3cccc(c23)[C@@]12C=C(C)C(=O)O2 |
| Start Substs in Alk. Biosynthesis (Prediction) |
L-Trp Anthranilate IPP |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Fungi | Trichocomaceae | Penicillium biforme | Ref. |
| Fungi | Trichocomaceae | Penicillium concavo-rugulosum | Ref. |
| Fungi | Trichocomaceae | Penicillium islandicum | Ref. |
| Fungi | Trichocomaceae | Penicillium purpurogenum | Ref. |
|
|
zoom in
| Organism | Penicillium biforme | | Reference | Cole,Handbook of Secondary Fungal Metabolites,Volume I,(2003)
Cole,Handbook of Toxic Fungal Metabolites,(1981),537 |
|---|
|